| General Information | |
|---|---|
| ZINC ID | ZINC000084652648 |
| Molecular Weight (Da) | 506 |
| SMILES | CC(=O)N1CCC(NC(=O)c2nn(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)c2C)CC1 |
| Molecular Formula | C24Cl3N4O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 131.943 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| LogP | 5.019 |
| Activity (Ki) in nM | 64.5654 |
| Polar Surface Area (PSA) | 67.23 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.011 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.29 |
| Ilogp | 4.46 |
| Xlogp3 | 5.46 |
| Wlogp | 5.17 |
| Mlogp | 4.2 |
| Silicos-it log p | 5.11 |
| Consensus log p | 4.88 |
| Esol log s | -6.4 |
| Esol solubility (mg/ml) | 0.000201 |
| Esol solubility (mol/l) | 0.00000039 |
| Esol class | Poorly sol |
| Ali log s | -6.63 |
| Ali solubility (mg/ml) | 0.000119 |
| Ali solubility (mol/l) | 0.00000023 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.32 |
| Silicos-it solubility (mg/ml) | 0.00000239 |
| Silicos-it solubility (mol/l) | 4.73E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.51 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.42 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.031 |
| Logd | 4.098 |
| Logp | 5.057 |
| F (20%) | 0.001 |
| F (30%) | 0.003 |
| Mdck | - |
| Ppb | 97.84% |
| Vdss | 1.192 |
| Fu | 3.01% |
| Cyp1a2-inh | 0.263 |
| Cyp1a2-sub | 0.467 |
| Cyp2c19-inh | 0.918 |
| Cyp2c19-sub | 0.397 |
| Cl | 3.343 |
| T12 | 0.048 |
| H-ht | 0.872 |
| Dili | 0.944 |
| Roa | 0.959 |
| Fdamdd | 0.464 |
| Skinsen | 0.059 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.025 |
| Bcf | 2.069 |
| Igc50 | 4.092 |
| Lc50 | 5.242 |
| Lc50dm | 5.452 |
| Nr-ar | 0.067 |
| Nr-ar-lbd | 0.017 |
| Nr-ahr | 0.872 |
| Nr-aromatase | 0.874 |
| Nr-er | 0.642 |
| Nr-er-lbd | 0.054 |
| Nr-ppar-gamma | 0.582 |
| Sr-are | 0.887 |
| Sr-atad5 | 0.233 |
| Sr-hse | 0.535 |
| Sr-mmp | 0.715 |
| Sr-p53 | 0.944 |
| Vol | 470.27 |
| Dense | 1.072 |
| Flex | 0.24 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.505 |
| Synth | 2.398 |
| Fsp3 | 0.292 |
| Mce-18 | 58.065 |
| Natural product-likeness | -1.505 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |