| General Information | |
|---|---|
| ZINC ID | ZINC000084633847 |
| Molecular Weight (Da) | 460 |
| SMILES | CN(CCO)C(=O)C(C)(C)NC(=O)c1cc2c(n(CC3CCCCC3)c1=O)CCCCCC2 |
| Molecular Formula | C26N3O4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 129.67 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| LogP | 4.222 |
| Activity (Ki) in nM | 0.603 |
| Polar Surface Area (PSA) | 91.64 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.506 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.73 |
| Ilogp | 3.57 |
| Xlogp3 | 4.07 |
| Wlogp | 3.05 |
| Mlogp | 2.47 |
| Silicos-it log p | 3.77 |
| Consensus log p | 3.38 |
| Esol log s | -4.79 |
| Esol solubility (mg/ml) | 0.00738 |
| Esol solubility (mol/l) | 0.0000161 |
| Esol class | Moderately |
| Ali log s | -5.7 |
| Ali solubility (mg/ml) | 0.000919 |
| Ali solubility (mol/l) | 0.000002 |
| Ali class | Moderately |
| Silicos-it logsw | -5.21 |
| Silicos-it solubility (mg/ml) | 0.00283 |
| Silicos-it solubility (mol/l) | 0.00000615 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.21 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.98 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.292 |
| Logd | 3.395 |
| Logp | 3.893 |
| F (20%) | 0.983 |
| F (30%) | 0.985 |
| Mdck | 1.90E-05 |
| Ppb | 0.8564 |
| Vdss | 0.845 |
| Fu | 0.0544 |
| Cyp1a2-inh | 0.107 |
| Cyp1a2-sub | 0.904 |
| Cyp2c19-inh | 0.813 |
| Cyp2c19-sub | 0.826 |
| Cl | 3.241 |
| T12 | 0.295 |
| H-ht | 0.933 |
| Dili | 0.273 |
| Roa | 0.354 |
| Fdamdd | 0.836 |
| Skinsen | 0.263 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.119 |
| Bcf | 1.01 |
| Igc50 | 4.519 |
| Lc50 | 4.411 |
| Lc50dm | 4.399 |
| Nr-ar | 0.014 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.186 |
| Nr-aromatase | 0.399 |
| Nr-er | 0.32 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.111 |
| Sr-are | 0.585 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.291 |
| Sr-mmp | 0.4 |
| Sr-p53 | 0.278 |
| Vol | 487.552 |
| Dense | 0.942 |
| Flex | 0.409 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0.656 |
| Synth | 2.858 |
| Fsp3 | 0.731 |
| Mce-18 | 53.2 |
| Natural product-likeness | -1 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |