| General Information | |
|---|---|
| ZINC ID | ZINC000084619337 |
| Molecular Weight (Da) | 328 |
| SMILES | O=C(NC1CCCCC1)c1cccnc1OCc1ccc(F)cc1 |
| Molecular Formula | C19F1N2O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 89.998 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| LogP | 4.06 |
| Activity (Ki) in nM | 1819.7 |
| Polar Surface Area (PSA) | 51.22 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.06968045 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.37 |
| Ilogp | 3.18 |
| Xlogp3 | 3.84 |
| Wlogp | 4.13 |
| Mlogp | 3.16 |
| Silicos-it log p | 4.06 |
| Consensus log p | 3.67 |
| Esol log s | -4.27 |
| Esol solubility (mg/ml) | 0.0177 |
| Esol solubility (mol/l) | 0.0000538 |
| Esol class | Moderately |
| Ali log s | -4.61 |
| Ali solubility (mg/ml) | 0.00803 |
| Ali solubility (mol/l) | 0.0000245 |
| Ali class | Moderately |
| Silicos-it logsw | -6.38 |
| Silicos-it solubility (mg/ml) | 0.000138 |
| Silicos-it solubility (mol/l) | 0.00000042 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.58 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 2.6 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.716 |
| Logd | 3.629 |
| Logp | 3.904 |
| F (20%) | 0.003 |
| F (30%) | 0.04 |
| Mdck | - |
| Ppb | 96.21% |
| Vdss | 2.1 |
| Fu | 2.37% |
| Cyp1a2-inh | 0.867 |
| Cyp1a2-sub | 0.159 |
| Cyp2c19-inh | 0.888 |
| Cyp2c19-sub | 0.142 |
| Cl | 4.668 |
| T12 | 0.049 |
| H-ht | 0.63 |
| Dili | 0.877 |
| Roa | 0.126 |
| Fdamdd | 0.888 |
| Skinsen | 0.148 |
| Ec | 0.003 |
| Ei | 0.014 |
| Respiratory | 0.542 |
| Bcf | 0.901 |
| Igc50 | 4.067 |
| Lc50 | 4.69 |
| Lc50dm | 6.188 |
| Nr-ar | 0.228 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.311 |
| Nr-aromatase | 0.819 |
| Nr-er | 0.269 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.787 |
| Sr-are | 0.396 |
| Sr-atad5 | 0.012 |
| Sr-hse | 0.34 |
| Sr-mmp | 0.615 |
| Sr-p53 | 0.278 |
| Vol | 338.697 |
| Dense | 0.969 |
| Flex | 0.316 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.906 |
| Synth | 1.927 |
| Fsp3 | 0.368 |
| Mce-18 | 36.923 |
| Natural product-likeness | -1.571 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |