| General Information | |
|---|---|
| ZINC ID | ZINC000073405178 |
| Molecular Weight (Da) | 459 |
| SMILES | CCc1c(C(=O)NC2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-n1c(C)ccc1C |
| Molecular Formula | C24Cl2N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 125.507 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 6.616 |
| Activity (Ki) in nM | 6.7608 |
| Polar Surface Area (PSA) | 51.85 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.987 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.42 |
| Ilogp | 4.76 |
| Xlogp3 | 6.9 |
| Wlogp | 6.21 |
| Mlogp | 4.92 |
| Silicos-it log p | 5.45 |
| Consensus log p | 5.65 |
| Esol log s | -7.02 |
| Esol solubility (mg/ml) | 0.0000437 |
| Esol solubility (mol/l) | 9.52E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.8 |
| Ali solubility (mg/ml) | 0.00000728 |
| Ali solubility (mol/l) | 1.58E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.93 |
| Silicos-it solubility (mg/ml) | 0.0000054 |
| Silicos-it solubility (mol/l) | 1.17E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.2 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.63 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.487 |
| Logd | 4.222 |
| Logp | 6.085 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 97.60% |
| Vdss | 0.824 |
| Fu | 2.28% |
| Cyp1a2-inh | 0.261 |
| Cyp1a2-sub | 0.944 |
| Cyp2c19-inh | 0.919 |
| Cyp2c19-sub | 0.855 |
| Cl | 4.684 |
| T12 | 0.138 |
| H-ht | 0.57 |
| Dili | 0.93 |
| Roa | 0.865 |
| Fdamdd | 0.924 |
| Skinsen | 0.096 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.762 |
| Bcf | 1.926 |
| Igc50 | 4.874 |
| Lc50 | 5.786 |
| Lc50dm | 5.284 |
| Nr-ar | 0.131 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.387 |
| Nr-aromatase | 0.929 |
| Nr-er | 0.588 |
| Nr-er-lbd | 0.033 |
| Nr-ppar-gamma | 0.691 |
| Sr-are | 0.775 |
| Sr-atad5 | 0.114 |
| Sr-hse | 0.203 |
| Sr-mmp | 0.868 |
| Sr-p53 | 0.905 |
| Vol | 451.542 |
| Dense | 1.015 |
| Flex | 0.261 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.493 |
| Synth | 2.654 |
| Fsp3 | 0.417 |
| Mce-18 | 56.471 |
| Natural product-likeness | -1.578 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |