| General Information | |
|---|---|
| ZINC ID | ZINC000073197469 |
| Molecular Weight (Da) | 366 |
| SMILES | CC1CCN(C(=O)c2ccc3[nH]c4c(c3c2)CN(C2CCCC2)CC4)CC1 |
| Molecular Formula | C23N3O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 109.503 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| LogP | 3.883 |
| Activity (Ki) in nM | 263.027 |
| Polar Surface Area (PSA) | 39.34 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.73540759 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.61 |
| Ilogp | 3.57 |
| Xlogp3 | 3.96 |
| Wlogp | 3.43 |
| Mlogp | 3.33 |
| Silicos-it log p | 4.3 |
| Consensus log p | 3.72 |
| Esol log s | -4.65 |
| Esol solubility (mg/ml) | 0.00819 |
| Esol solubility (mol/l) | 0.0000224 |
| Esol class | Moderately |
| Ali log s | -4.49 |
| Ali solubility (mg/ml) | 0.0119 |
| Ali solubility (mol/l) | 0.0000326 |
| Ali class | Moderately |
| Silicos-it logsw | -5.39 |
| Silicos-it solubility (mg/ml) | 0.0015 |
| Silicos-it solubility (mol/l) | 0.00000411 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.72 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 1 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.69 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.014 |
| Logd | 3.733 |
| Logp | 3.961 |
| F (20%) | 0.048 |
| F (30%) | 0.003 |
| Mdck | - |
| Ppb | 88.40% |
| Vdss | 2.428 |
| Fu | 8.29% |
| Cyp1a2-inh | 0.199 |
| Cyp1a2-sub | 0.945 |
| Cyp2c19-inh | 0.373 |
| Cyp2c19-sub | 0.131 |
| Cl | 4.413 |
| T12 | 0.16 |
| H-ht | 0.956 |
| Dili | 0.354 |
| Roa | 0.801 |
| Fdamdd | 0.765 |
| Skinsen | 0.735 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.989 |
| Bcf | 0.771 |
| Igc50 | 3.952 |
| Lc50 | 4.185 |
| Lc50dm | 5.339 |
| Nr-ar | 0.368 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.796 |
| Nr-aromatase | 0.094 |
| Nr-er | 0.137 |
| Nr-er-lbd | 0.036 |
| Nr-ppar-gamma | 0.006 |
| Sr-are | 0.385 |
| Sr-atad5 | 0.012 |
| Sr-hse | 0.167 |
| Sr-mmp | 0.109 |
| Sr-p53 | 0.026 |
| Vol | 392.18 |
| Dense | 0.931 |
| Flex | 0.111 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.86 |
| Synth | 2.415 |
| Fsp3 | 0.609 |
| Mce-18 | 67.568 |
| Natural product-likeness | -0.949 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |