| General Information | |
|---|---|
| ZINC ID | ZINC000073165597 |
| Molecular Weight (Da) | 453 |
| SMILES | CCCCCCC(C)(C)c1cc(O)cc(OCCCCCCCC(=O)OC(CO)CO)c1 |
| Molecular Formula | C26O6 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 126.853 |
| HBA | 6 |
| HBD | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| LogP | 6.279 |
| Activity (Ki) in nM | 1122.02 |
| Polar Surface Area (PSA) | 96.22 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.75704908 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.73 |
| Ilogp | 3.85 |
| Xlogp3 | 6.59 |
| Wlogp | 5.26 |
| Mlogp | 3.28 |
| Silicos-it log p | 6.49 |
| Consensus log p | 5.09 |
| Esol log s | -5.68 |
| Esol solubility (mg/ml) | 0.00094 |
| Esol solubility (mol/l) | 0.00000208 |
| Esol class | Moderately |
| Ali log s | -8.41 |
| Ali solubility (mg/ml) | 0.00000176 |
| Ali solubility (mol/l) | 3.89E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.9 |
| Silicos-it solubility (mg/ml) | 0.000057 |
| Silicos-it solubility (mol/l) | 0.00000012 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.38 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 1 |
| Egan number of violations | 0 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.93 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.291 |
| Logd | 4.194 |
| Logp | 6.319 |
| F (20%) | 0.998 |
| F (30%) | 0.981 |
| Mdck | - |
| Ppb | 96.97% |
| Vdss | 0.862 |
| Fu | 2.55% |
| Cyp1a2-inh | 0.291 |
| Cyp1a2-sub | 0.208 |
| Cyp2c19-inh | 0.295 |
| Cyp2c19-sub | 0.061 |
| Cl | 8.673 |
| T12 | 0.712 |
| H-ht | 0.047 |
| Dili | 0.026 |
| Roa | 0.018 |
| Fdamdd | 0.045 |
| Skinsen | 0.93 |
| Ec | 0.003 |
| Ei | 0.09 |
| Respiratory | 0.11 |
| Bcf | 1.162 |
| Igc50 | 5.277 |
| Lc50 | 5.111 |
| Lc50dm | 4.531 |
| Nr-ar | 0.498 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.041 |
| Nr-aromatase | 0.735 |
| Nr-er | 0.656 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.79 |
| Sr-are | 0.513 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.84 |
| Sr-mmp | 0.964 |
| Sr-p53 | 0.642 |
| Vol | 491.891 |
| Dense | 0.92 |
| Flex | 2.714 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.208 |
| Synth | 2.672 |
| Fsp3 | 0.731 |
| Mce-18 | 11 |
| Natural product-likeness | 0.663 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |