| General Information | |
|---|---|
| ZINC ID | ZINC000073129851 |
| Molecular Weight (Da) | 563 |
| SMILES | Cc1c(C(=O)NCc2ccc(Cl)c(Cl)c2)nn(-c2ccc(Cl)cc2Cl)c1-n1c(Cl)ccc1Cl |
| Molecular Formula | C22Cl6N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 136.047 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| LogP | 8.401 |
| Activity (Ki) in nM | 134.896 |
| Polar Surface Area (PSA) | 51.85 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.043 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.09 |
| Ilogp | 4.91 |
| Xlogp3 | 8.53 |
| Wlogp | 7.67 |
| Mlogp | 6.17 |
| Silicos-it log p | 6.88 |
| Consensus log p | 6.83 |
| Esol log s | -8.8 |
| Esol solubility (mg/ml) | 0.00000088 |
| Esol solubility (mol/l) | 1.58E-09 |
| Esol class | Poorly sol |
| Ali log s | -9.49 |
| Ali solubility (mg/ml) | 0.00000018 |
| Ali solubility (mol/l) | 3.22E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.58 |
| Silicos-it solubility (mg/ml) | 1.48E-08 |
| Silicos-it solubility (mol/l) | 2.63E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.68 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.2 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.533 |
| Logd | 2.963 |
| Logp | 6.647 |
| F (20%) | 0 |
| F (30%) | 0.001 |
| Mdck | 5.18E-06 |
| Ppb | 1.0059 |
| Vdss | 0.317 |
| Fu | 0.0172 |
| Cyp1a2-inh | 0.472 |
| Cyp1a2-sub | 0.789 |
| Cyp2c19-inh | 0.92 |
| Cyp2c19-sub | 0.426 |
| Cl | 4.332 |
| T12 | 0.101 |
| H-ht | 0.197 |
| Dili | 0.945 |
| Roa | 0.822 |
| Fdamdd | 0.926 |
| Skinsen | 0.053 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.043 |
| Bcf | 3.979 |
| Igc50 | 5.502 |
| Lc50 | 6.766 |
| Lc50dm | 6.656 |
| Nr-ar | 0.068 |
| Nr-ar-lbd | 0.022 |
| Nr-ahr | 0.85 |
| Nr-aromatase | 0.9 |
| Nr-er | 0.601 |
| Nr-er-lbd | 0.299 |
| Nr-ppar-gamma | 0.525 |
| Sr-are | 0.942 |
| Sr-atad5 | 0.276 |
| Sr-hse | 0.254 |
| Sr-mmp | 0.959 |
| Sr-p53 | 0.94 |
| Vol | 469.885 |
| Dense | 1.192 |
| Flex | 0.261 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.269 |
| Synth | 2.807 |
| Fsp3 | 0.091 |
| Mce-18 | 26 |
| Natural product-likeness | -1.533 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |