| General Information | |
|---|---|
| ZINC ID | ZINC000072112255 |
| Molecular Weight (Da) | 574 |
| SMILES | Cc1c(C(=O)NC(C)(C)c2nc(C(F)(F)F)cs2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C24Cl3F3N4O1S1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 137.186 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| LogP | 7.865 |
| Activity (Ki) in nM | 1.9953 |
| Polar Surface Area (PSA) | 88.05 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.925 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.21 |
| Ilogp | 4.96 |
| Xlogp3 | 7.48 |
| Wlogp | 8.99 |
| Mlogp | 5.06 |
| Silicos-it log p | 8.1 |
| Consensus log p | 6.92 |
| Esol log s | -8.1 |
| Esol solubility (mg/ml) | 0.00000455 |
| Esol solubility (mol/l) | 7.93E-09 |
| Esol class | Poorly sol |
| Ali log s | -9.16 |
| Ali solubility (mg/ml) | 0.00000039 |
| Ali solubility (mol/l) | 6.88E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.54 |
| Silicos-it solubility (mg/ml) | 1.67E-08 |
| Silicos-it solubility (mol/l) | 2.92E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.49 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.63 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.037 |
| Logd | 5.111 |
| Logp | 6.379 |
| F (20%) | 0.002 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 100.97% |
| Vdss | 2.93 |
| Fu | 1.20% |
| Cyp1a2-inh | 0.277 |
| Cyp1a2-sub | 0.911 |
| Cyp2c19-inh | 0.92 |
| Cyp2c19-sub | 0.181 |
| Cl | 2.061 |
| T12 | 0.012 |
| H-ht | 0.7 |
| Dili | 0.977 |
| Roa | 0.549 |
| Fdamdd | 0.881 |
| Skinsen | 0.027 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.388 |
| Bcf | 1.777 |
| Igc50 | 5.025 |
| Lc50 | 6.77 |
| Lc50dm | 6.541 |
| Nr-ar | 0.005 |
| Nr-ar-lbd | 0.306 |
| Nr-ahr | 0.948 |
| Nr-aromatase | 0.964 |
| Nr-er | 0.913 |
| Nr-er-lbd | 0.12 |
| Nr-ppar-gamma | 0.94 |
| Sr-are | 0.939 |
| Sr-atad5 | 0.409 |
| Sr-hse | 0.724 |
| Sr-mmp | 0.964 |
| Sr-p53 | 0.98 |
| Vol | 495.555 |
| Dense | 1.154 |
| Flex | 0.304 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.264 |
| Synth | 2.889 |
| Fsp3 | 0.208 |
| Mce-18 | 30 |
| Natural product-likeness | -1.489 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |