| General Information | |
|---|---|
| ZINC ID | ZINC000072110893 |
| Molecular Weight (Da) | 490 |
| SMILES | COc1cc(C(=O)NC2(C(=O)N[C@H](C)c3ccc(-n4ccc(-c5ccccc5)n4)cc3F)CC2)on1 |
| Molecular Formula | C26F1N5O4 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 128 |
| HBA | 6 |
| HBD | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| LogP | 3.752 |
| Activity (Ki) in nM | 616.595 |
| Polar Surface Area (PSA) | 111.28 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.94069159 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.23 |
| Ilogp | 3.57 |
| Xlogp3 | 3.6 |
| Wlogp | 3.85 |
| Mlogp | 2.5 |
| Silicos-it log p | 3.65 |
| Consensus log p | 3.44 |
| Esol log s | -4.94 |
| Esol solubility (mg/ml) | 0.00568 |
| Esol solubility (mol/l) | 0.0000116 |
| Esol class | Moderately |
| Ali log s | -5.62 |
| Ali solubility (mg/ml) | 0.00116 |
| Ali solubility (mol/l) | 0.00000238 |
| Ali class | Moderately |
| Silicos-it logsw | -8.3 |
| Silicos-it solubility (mg/ml) | 0.00000246 |
| Silicos-it solubility (mol/l) | 5.04E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.73 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.2 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.617 |
| Logd | 3.915 |
| Logp | 4.099 |
| F (20%) | 0.001 |
| F (30%) | 0.005 |
| Mdck | - |
| Ppb | 97.93% |
| Vdss | 0.619 |
| Fu | 1.56% |
| Cyp1a2-inh | 0.358 |
| Cyp1a2-sub | 0.32 |
| Cyp2c19-inh | 0.75 |
| Cyp2c19-sub | 0.41 |
| Cl | 1.483 |
| T12 | 0.032 |
| H-ht | 0.953 |
| Dili | 0.99 |
| Roa | 0.155 |
| Fdamdd | 0.924 |
| Skinsen | 0.092 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.467 |
| Bcf | 0.851 |
| Igc50 | 3.119 |
| Lc50 | 5.625 |
| Lc50dm | 5.837 |
| Nr-ar | 0.024 |
| Nr-ar-lbd | 0.015 |
| Nr-ahr | 0.871 |
| Nr-aromatase | 0.032 |
| Nr-er | 0.728 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.013 |
| Sr-are | 0.798 |
| Sr-atad5 | 0.845 |
| Sr-hse | 0.003 |
| Sr-mmp | 0.463 |
| Sr-p53 | 0.81 |
| Vol | 480.045 |
| Dense | 1.019 |
| Flex | 0.37 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.389 |
| Synth | 3.258 |
| Fsp3 | 0.231 |
| Mce-18 | 92.438 |
| Natural product-likeness | -1.888 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |