| General Information | |
|---|---|
| ZINC ID | ZINC000072109176 |
| Molecular Weight (Da) | 306 |
| SMILES | CCS(=O)(=O)c1ccc2c(c1)nc(C(C)(C)C)n2C1CC1 |
| Molecular Formula | C16N2O2S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 82.537 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| LogP | 3.678 |
| Activity (Ki) in nM | 107.152 |
| Polar Surface Area (PSA) | 60.34 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.30750361 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.56 |
| Ilogp | 2.86 |
| Xlogp3 | 3.21 |
| Wlogp | 4.48 |
| Mlogp | 2.74 |
| Silicos-it log p | 2.8 |
| Consensus log p | 3.22 |
| Esol log s | -3.82 |
| Esol solubility (mg/ml) | 4.69E-02 |
| Esol solubility (mol/l) | 1.53E-04 |
| Esol class | Soluble |
| Ali log s | -4.15 |
| Ali solubility (mg/ml) | 2.17E-02 |
| Ali solubility (mol/l) | 7.09E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -4.6 |
| Silicos-it solubility (mg/ml) | 7.71E-03 |
| Silicos-it solubility (mol/l) | 2.52E-05 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.89 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 0 |
| Synthetic accessibility | 2.74 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.956 |
| Logd | 2.587 |
| Logp | 2.77 |
| F (20%) | 0.004 |
| F (30%) | 0.007 |
| Mdck | 3.18E-05 |
| Ppb | 0.7709 |
| Vdss | 0.755 |
| Fu | 0.4015 |
| Cyp1a2-inh | 0.37 |
| Cyp1a2-sub | 0.781 |
| Cyp2c19-inh | 0.634 |
| Cyp2c19-sub | 0.873 |
| Cl | 1.963 |
| T12 | 0.07 |
| H-ht | 0.563 |
| Dili | 0.892 |
| Roa | 0.592 |
| Fdamdd | 0.911 |
| Skinsen | 0.071 |
| Ec | 0.003 |
| Ei | 0.026 |
| Respiratory | 0.914 |
| Bcf | 0.937 |
| Igc50 | 3.445 |
| Lc50 | 4.078 |
| Lc50dm | 4.461 |
| Nr-ar | 0.008 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.062 |
| Nr-aromatase | 0.422 |
| Nr-er | 0.354 |
| Nr-er-lbd | 0.081 |
| Nr-ppar-gamma | 0.004 |
| Sr-are | 0.489 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.015 |
| Sr-mmp | 0.436 |
| Sr-p53 | 0.072 |
| Vol | 307.16 |
| Dense | 0.997 |
| Flex | 15 |
| Nstereo | 0.267 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 3 |
| Synth | 0.872 |
| Fsp3 | 2.453 |
| Mce-18 | 0.562 |
| Natural product-likeness | 47.04 |
| Alarm nmr | -1.804 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Accepted |
| Goldentriangle | Accepted |