| General Information | |
|---|---|
| ZINC ID | ZINC000071318879 |
| Molecular Weight (Da) | 448 |
| SMILES | CC(C)N(CCO)Cc1csc(-c2cn(CC3CCOCC3)c3c(Cl)cccc23)n1 |
| Molecular Formula | C23Cl1N3O2S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.48 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| LogP | 3.86 |
| Activity (Ki) in nM | 10 |
| Polar Surface Area (PSA) | 78.76 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.681 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 14 |
| Fraction csp3 | 0.52 |
| Ilogp | 4.23 |
| Xlogp3 | 3.84 |
| Wlogp | 4.9 |
| Mlogp | 2.46 |
| Silicos-it log p | 5.54 |
| Consensus log p | 4.19 |
| Esol log s | -4.85 |
| Esol solubility (mg/ml) | 0.00627 |
| Esol solubility (mol/l) | 0.000014 |
| Esol class | Moderately |
| Ali log s | -5.19 |
| Ali solubility (mg/ml) | 0.00289 |
| Ali solubility (mol/l) | 0.00000646 |
| Ali class | Moderately |
| Silicos-it logsw | -6.47 |
| Silicos-it solubility (mg/ml) | 0.000153 |
| Silicos-it solubility (mol/l) | 0.00000034 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.31 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.79 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.457 |
| Logd | 3.855 |
| Logp | 4.381 |
| F (20%) | 0.007 |
| F (30%) | 0.005 |
| Mdck | - |
| Ppb | 94.58% |
| Vdss | 2.022 |
| Fu | 2.96% |
| Cyp1a2-inh | 0.832 |
| Cyp1a2-sub | 0.67 |
| Cyp2c19-inh | 0.939 |
| Cyp2c19-sub | 0.201 |
| Cl | 9.822 |
| T12 | 0.043 |
| H-ht | 0.954 |
| Dili | 0.463 |
| Roa | 0.166 |
| Fdamdd | 0.221 |
| Skinsen | 0.035 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.674 |
| Bcf | 1.828 |
| Igc50 | 3.939 |
| Lc50 | 4.455 |
| Lc50dm | 4.182 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.011 |
| Nr-ahr | 0.198 |
| Nr-aromatase | 0.6 |
| Nr-er | 0.178 |
| Nr-er-lbd | 0.017 |
| Nr-ppar-gamma | 0.077 |
| Sr-are | 0.317 |
| Sr-atad5 | 0.038 |
| Sr-hse | 0.686 |
| Sr-mmp | 0.351 |
| Sr-p53 | 0.39 |
| Vol | 440.61 |
| Dense | 1.015 |
| Flex | 0.381 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.525 |
| Synth | 2.873 |
| Fsp3 | 0.522 |
| Mce-18 | 50.286 |
| Natural product-likeness | -1.65 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |