| General Information | |
|---|---|
| ZINC ID | ZINC000071317808 |
| Molecular Weight (Da) | 420 |
| SMILES | CN(CCO)Cc1csc(-c2cn(CC3CCOCC3)c3c(Cl)cccc23)n1 |
| Molecular Formula | C21Cl1N3O2S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 113.314 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| LogP | 3.133 |
| Activity (Ki) in nM | 39.8107 |
| Polar Surface Area (PSA) | 78.76 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.679 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 14 |
| Fraction csp3 | 0.48 |
| Ilogp | 3.91 |
| Xlogp3 | 3.04 |
| Wlogp | 4.12 |
| Mlogp | 2.03 |
| Silicos-it log p | 4.92 |
| Consensus log p | 3.6 |
| Esol log s | -4.27 |
| Esol solubility (mg/ml) | 0.0227 |
| Esol solubility (mol/l) | 0.0000541 |
| Esol class | Moderately |
| Ali log s | -4.36 |
| Ali solubility (mg/ml) | 0.0183 |
| Ali solubility (mol/l) | 0.0000437 |
| Ali class | Moderately |
| Silicos-it logsw | -6.06 |
| Silicos-it solubility (mg/ml) | 0.000367 |
| Silicos-it solubility (mol/l) | 0.00000087 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.7 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.56 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.33 |
| Logd | 3.402 |
| Logp | 3.772 |
| F (20%) | 0.045 |
| F (30%) | 0.011 |
| Mdck | - |
| Ppb | 90.80% |
| Vdss | 2.429 |
| Fu | 3.85% |
| Cyp1a2-inh | 0.918 |
| Cyp1a2-sub | 0.787 |
| Cyp2c19-inh | 0.932 |
| Cyp2c19-sub | 0.551 |
| Cl | 10.327 |
| T12 | 0.036 |
| H-ht | 0.936 |
| Dili | 0.777 |
| Roa | 0.206 |
| Fdamdd | 0.75 |
| Skinsen | 0.05 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.835 |
| Bcf | 1.556 |
| Igc50 | 3.859 |
| Lc50 | 4.419 |
| Lc50dm | 4.178 |
| Nr-ar | 0.013 |
| Nr-ar-lbd | 0.114 |
| Nr-ahr | 0.391 |
| Nr-aromatase | 0.625 |
| Nr-er | 0.158 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.63 |
| Sr-are | 0.255 |
| Sr-atad5 | 0.074 |
| Sr-hse | 0.689 |
| Sr-mmp | 0.368 |
| Sr-p53 | 0.688 |
| Vol | 406.018 |
| Dense | 1.032 |
| Flex | 0.333 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.621 |
| Synth | 2.79 |
| Fsp3 | 0.476 |
| Mce-18 | 48.774 |
| Natural product-likeness | -1.734 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |