| General Information | |
|---|---|
| ZINC ID | ZINC000066259691 |
| Molecular Weight (Da) | 367 |
| SMILES | COc1ccc(F)c(-c2c[nH]c(-c3cccc(CN4CCOCC4)c3)n2)c1 |
| Molecular Formula | C21F1N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 103.163 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| LogP | 3.069 |
| Activity (Ki) in nM | 141.254 |
| Polar Surface Area (PSA) | 50.38 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.89888358 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.29 |
| Ilogp | 3.35 |
| Xlogp3 | 2.92 |
| Wlogp | 3.61 |
| Mlogp | 2.25 |
| Silicos-it log p | 4.76 |
| Consensus log p | 3.38 |
| Esol log s | -4.09 |
| Esol solubility (mg/ml) | 0.0296 |
| Esol solubility (mol/l) | 0.0000806 |
| Esol class | Moderately |
| Ali log s | -3.64 |
| Ali solubility (mg/ml) | 0.0843 |
| Ali solubility (mol/l) | 0.000229 |
| Ali class | Soluble |
| Silicos-it logsw | -7.21 |
| Silicos-it solubility (mg/ml) | 0.0000224 |
| Silicos-it solubility (mol/l) | 0.00000006 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.47 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.07 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.433 |
| Logd | 3.664 |
| Logp | 3.697 |
| F (20%) | 0.003 |
| F (30%) | 0.016 |
| Mdck | - |
| Ppb | 97.80% |
| Vdss | 1.559 |
| Fu | 3.31% |
| Cyp1a2-inh | 0.922 |
| Cyp1a2-sub | 0.678 |
| Cyp2c19-inh | 0.943 |
| Cyp2c19-sub | 0.099 |
| Cl | 10.679 |
| T12 | 0.159 |
| H-ht | 0.646 |
| Dili | 0.274 |
| Roa | 0.523 |
| Fdamdd | 0.896 |
| Skinsen | 0.343 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.674 |
| Bcf | 2.169 |
| Igc50 | 3.886 |
| Lc50 | 5.151 |
| Lc50dm | 6.406 |
| Nr-ar | 0.146 |
| Nr-ar-lbd | 0.01 |
| Nr-ahr | 0.69 |
| Nr-aromatase | 0.909 |
| Nr-er | 0.563 |
| Nr-er-lbd | 0.017 |
| Nr-ppar-gamma | 0.004 |
| Sr-are | 0.761 |
| Sr-atad5 | 0.573 |
| Sr-hse | 0.019 |
| Sr-mmp | 0.212 |
| Sr-p53 | 0.25 |
| Vol | 373.093 |
| Dense | 0.984 |
| Flex | 0.217 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.747 |
| Synth | 2.492 |
| Fsp3 | 0.286 |
| Mce-18 | 45.926 |
| Natural product-likeness | -1.402 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |