| General Information | |
|---|---|
| ZINC ID | ZINC000066259450 |
| Molecular Weight (Da) | 403 |
| SMILES | FC1CCN(Cc2ccccc2-c2nc(-c3cccc(C(F)(F)F)c3)c[nH]2)CC1 |
| Molecular Formula | C22F4N3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 105.415 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| LogP | 4.507 |
| Activity (Ki) in nM | 128.825 |
| Polar Surface Area (PSA) | 31.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.97791761 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.32 |
| Ilogp | 3.27 |
| Xlogp3 | 5 |
| Wlogp | 6.74 |
| Mlogp | 4.2 |
| Silicos-it log p | 5.98 |
| Consensus log p | 5.04 |
| Esol log s | -5.59 |
| Esol solubility (mg/ml) | 1.03E-03 |
| Esol solubility (mol/l) | 2.54E-06 |
| Esol class | Moderately |
| Ali log s | -5.41 |
| Ali solubility (mg/ml) | 1.57E-03 |
| Ali solubility (mol/l) | 3.89E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -8.25 |
| Silicos-it solubility (mg/ml) | 2.26E-06 |
| Silicos-it solubility (mol/l) | 5.60E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.21 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.15 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.531 |
| Logd | 4.633 |
| Logp | 5.041 |
| F (20%) | 0.004 |
| F (30%) | 0.018 |
| Mdck | 9.78E-06 |
| Ppb | 0.9708 |
| Vdss | 3.019 |
| Fu | 0.0246 |
| Cyp1a2-inh | 0.905 |
| Cyp1a2-sub | 0.632 |
| Cyp2c19-inh | 0.626 |
| Cyp2c19-sub | 0.076 |
| Cl | 9.138 |
| T12 | 0.03 |
| H-ht | 0.758 |
| Dili | 0.165 |
| Roa | 0.399 |
| Fdamdd | 0.943 |
| Skinsen | 0.042 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.785 |
| Bcf | 2.297 |
| Igc50 | 4.466 |
| Lc50 | 6.064 |
| Lc50dm | 6.409 |
| Nr-ar | 0.018 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.3 |
| Nr-aromatase | 0.932 |
| Nr-er | 0.188 |
| Nr-er-lbd | 0.01 |
| Nr-ppar-gamma | 0.007 |
| Sr-are | 0.421 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.383 |
| Sr-mmp | 0.21 |
| Sr-p53 | 0.058 |
| Vol | 391.011 |
| Dense | 1.031 |
| Flex | 23 |
| Nstereo | 0.217 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 0 |
| Synth | 0.567 |
| Fsp3 | 2.695 |
| Mce-18 | 0.318 |
| Natural product-likeness | 53.931 |
| Alarm nmr | -1.198 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |