| General Information | |
|---|---|
| ZINC ID | ZINC000066259437 |
| Molecular Weight (Da) | 405 |
| SMILES | Cc1c(C(=O)NC(C)C)nn(-c2ccc(Cl)cc2Cl)c1-n1c(C)ccc1C |
| Molecular Formula | C20Cl2N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 109.058 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| LogP | 5.027 |
| Activity (Ki) in nM | 1778.279 |
| Polar Surface Area (PSA) | 51.85 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.09605121 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.3 |
| Ilogp | 4.22 |
| Xlogp3 | 5.46 |
| Wlogp | 5.03 |
| Mlogp | 4.08 |
| Silicos-it log p | 4.5 |
| Consensus log p | 4.66 |
| Esol log s | -5.9 |
| Esol solubility (mg/ml) | 0.000509 |
| Esol solubility (mol/l) | 0.00000126 |
| Esol class | Moderately |
| Ali log s | -6.31 |
| Ali solubility (mg/ml) | 0.0002 |
| Ali solubility (mol/l) | 0.00000049 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.96 |
| Silicos-it solubility (mg/ml) | 0.000044 |
| Silicos-it solubility (mol/l) | 0.0000001 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.9 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.25 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.59 |
| Logd | 3.415 |
| Logp | 4.718 |
| F (20%) | 0.002 |
| F (30%) | 0.009 |
| Mdck | 1.09E-05 |
| Ppb | 0.9797 |
| Vdss | 0.81 |
| Fu | 0.0189 |
| Cyp1a2-inh | 0.248 |
| Cyp1a2-sub | 0.933 |
| Cyp2c19-inh | 0.906 |
| Cyp2c19-sub | 0.93 |
| Cl | 5.458 |
| T12 | 0.292 |
| H-ht | 0.175 |
| Dili | 0.921 |
| Roa | 0.234 |
| Fdamdd | 0.341 |
| Skinsen | 0.04 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.183 |
| Bcf | 2.73 |
| Igc50 | 4.276 |
| Lc50 | 5.276 |
| Lc50dm | 5.23 |
| Nr-ar | 0.038 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.751 |
| Nr-aromatase | 0.936 |
| Nr-er | 0.465 |
| Nr-er-lbd | 0.044 |
| Nr-ppar-gamma | 0.014 |
| Sr-are | 0.653 |
| Sr-atad5 | 0.017 |
| Sr-hse | 0.029 |
| Sr-mmp | 0.303 |
| Sr-p53 | 0.798 |
| Vol | 390.915 |
| Dense | 1.034 |
| Flex | 0.294 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.662 |
| Synth | 2.577 |
| Fsp3 | 0.3 |
| Mce-18 | 21 |
| Natural product-likeness | -1.78 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |