| General Information | |
|---|---|
| ZINC ID | ZINC000066259396 |
| Molecular Weight (Da) | 383 |
| SMILES | COc1ccc(F)c(-c2c[nH]c(-c3cccc(CN4CCC(F)CC4)c3)n2)c1 |
| Molecular Formula | C22F2N3O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 106.121 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| LogP | 3.754 |
| Activity (Ki) in nM | 5.012 |
| Polar Surface Area (PSA) | 41.15 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.986 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.32 |
| Ilogp | 3.44 |
| Xlogp3 | 4.19 |
| Wlogp | 5.13 |
| Mlogp | 3.41 |
| Silicos-it log p | 5.4 |
| Consensus log p | 4.31 |
| Esol log s | -4.98 |
| Esol solubility (mg/ml) | 0.00405 |
| Esol solubility (mol/l) | 0.0000106 |
| Esol class | Moderately |
| Ali log s | -4.76 |
| Ali solubility (mg/ml) | 0.00661 |
| Ali solubility (mol/l) | 0.0000172 |
| Ali class | Moderately |
| Silicos-it logsw | -7.79 |
| Silicos-it solubility (mg/ml) | 0.00000622 |
| Silicos-it solubility (mol/l) | 1.62E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.66 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.07 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.98 |
| Logd | 4.128 |
| Logp | 4.585 |
| F (20%) | 0.002 |
| F (30%) | 0.004 |
| Mdck | 1.06E-05 |
| Ppb | 0.9689 |
| Vdss | 3.014 |
| Fu | 0.0331 |
| Cyp1a2-inh | 0.861 |
| Cyp1a2-sub | 0.881 |
| Cyp2c19-inh | 0.722 |
| Cyp2c19-sub | 0.096 |
| Cl | 9.775 |
| T12 | 0.066 |
| H-ht | 0.503 |
| Dili | 0.387 |
| Roa | 0.438 |
| Fdamdd | 0.918 |
| Skinsen | 0.171 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.694 |
| Bcf | 2.951 |
| Igc50 | 4.561 |
| Lc50 | 5.982 |
| Lc50dm | 6.456 |
| Nr-ar | 0.088 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.266 |
| Nr-aromatase | 0.892 |
| Nr-er | 0.096 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.004 |
| Sr-are | 0.578 |
| Sr-atad5 | 0.068 |
| Sr-hse | 0.069 |
| Sr-mmp | 0.129 |
| Sr-p53 | 0.028 |
| Vol | 387.666 |
| Dense | 0.988 |
| Flex | 0.217 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 2 |
| Toxicophores | 0 |
| Qed | 0.686 |
| Synth | 2.655 |
| Fsp3 | 0.318 |
| Mce-18 | 49.241 |
| Natural product-likeness | -1.144 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 2 |
| Gsk | Rejected |
| Goldentriangle | Accepted |