| General Information | |
|---|---|
| ZINC ID | ZINC000066252653 |
| Molecular Weight (Da) | 405 |
| SMILES | CCn1cc(C(=O)N[C@H](C)C23CC4CC(CC(C4)C2)C3)c(=O)cc1-c1ccccc1 |
| Molecular Formula | C26N2O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 116.818 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| LogP | 5.136 |
| Activity (Ki) in nM | 416.869 |
| Polar Surface Area (PSA) | 51.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.87408161 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.54 |
| Ilogp | 3.57 |
| Xlogp3 | 5.66 |
| Wlogp | 4.87 |
| Mlogp | 3.53 |
| Silicos-it log p | 4.87 |
| Consensus log p | 4.5 |
| Esol log s | -5.81 |
| Esol solubility (mg/ml) | 6.21E-04 |
| Esol solubility (mol/l) | 1.53E-06 |
| Esol class | Moderately |
| Ali log s | -6.5 |
| Ali solubility (mg/ml) | 1.29E-04 |
| Ali solubility (mol/l) | 3.18E-07 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.84 |
| Silicos-it solubility (mg/ml) | 5.90E-05 |
| Silicos-it solubility (mol/l) | 1.46E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.75 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.49 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.713 |
| Logd | 4.33 |
| Logp | 5.168 |
| F (20%) | 0.002 |
| F (30%) | 0.009 |
| Mdck | 1.71E-05 |
| Ppb | 0.9012 |
| Vdss | 0.745 |
| Fu | 0.0404 |
| Cyp1a2-inh | 0.181 |
| Cyp1a2-sub | 0.17 |
| Cyp2c19-inh | 0.731 |
| Cyp2c19-sub | 0.069 |
| Cl | 2.645 |
| T12 | 0.026 |
| H-ht | 0.556 |
| Dili | 0.17 |
| Roa | 0.041 |
| Fdamdd | 0.774 |
| Skinsen | 0.032 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.526 |
| Bcf | 3.021 |
| Igc50 | 4.492 |
| Lc50 | 5.552 |
| Lc50dm | 6.566 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.102 |
| Nr-aromatase | 0.954 |
| Nr-er | 0.131 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.037 |
| Sr-are | 0.444 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.847 |
| Sr-mmp | 0.715 |
| Sr-p53 | 0.529 |
| Vol | 436.589 |
| Dense | 0.926 |
| Flex | 26 |
| Nstereo | 0.231 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.773 |
| Fsp3 | 4.201 |
| Mce-18 | 0.538 |
| Natural product-likeness | 98 |
| Alarm nmr | -0.474 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |