| General Information | |
|---|---|
| ZINC ID | ZINC000066252492 |
| Molecular Weight (Da) | 433 |
| SMILES | CCCCCn1cc(C(=O)NCC23CC4CC(CC(C4)C2)C3)c(=O)cc1-c1ccccc1 |
| Molecular Formula | C28N2O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 126.126 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| LogP | 6.195 |
| Activity (Ki) in nM | 630.957 |
| Polar Surface Area (PSA) | 51.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.91335493 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.57 |
| Ilogp | 4.27 |
| Xlogp3 | 6.65 |
| Wlogp | 5.65 |
| Mlogp | 3.93 |
| Silicos-it log p | 5.84 |
| Consensus log p | 5.27 |
| Esol log s | -6.4 |
| Esol solubility (mg/ml) | 0.000174 |
| Esol solubility (mol/l) | 0.0000004 |
| Esol class | Poorly sol |
| Ali log s | -7.53 |
| Ali solubility (mg/ml) | 0.0000129 |
| Ali solubility (mol/l) | 2.99E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.99 |
| Silicos-it solubility (mg/ml) | 0.0000044 |
| Silicos-it solubility (mol/l) | 1.02E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.22 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.62 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.558 |
| Logd | 4.621 |
| Logp | 6.085 |
| F (20%) | 0.056 |
| F (30%) | 0.446 |
| Mdck | - |
| Ppb | 94.53% |
| Vdss | 0.713 |
| Fu | 1.86% |
| Cyp1a2-inh | 0.13 |
| Cyp1a2-sub | 0.146 |
| Cyp2c19-inh | 0.714 |
| Cyp2c19-sub | 0.07 |
| Cl | 3.182 |
| T12 | 0.012 |
| H-ht | 0.688 |
| Dili | 0.073 |
| Roa | 0.254 |
| Fdamdd | 0.499 |
| Skinsen | 0.027 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.54 |
| Bcf | 2.972 |
| Igc50 | 4.967 |
| Lc50 | 5.832 |
| Lc50dm | 6.365 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.403 |
| Nr-aromatase | 0.947 |
| Nr-er | 0.22 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.015 |
| Sr-are | 0.555 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.87 |
| Sr-mmp | 0.832 |
| Sr-p53 | 0.639 |
| Vol | 471.181 |
| Dense | 0.917 |
| Flex | 0.346 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.548 |
| Synth | 3.738 |
| Fsp3 | 0.571 |
| Mce-18 | 66.273 |
| Natural product-likeness | -0.443 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |