| General Information | |
|---|---|
| ZINC ID | ZINC000066251645 |
| Molecular Weight (Da) | 391 |
| SMILES | CCCCNC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-n2cccc2)c1C |
| Molecular Formula | C19Cl2N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 103.966 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| LogP | 5.065 |
| Activity (Ki) in nM | 794.328 |
| Polar Surface Area (PSA) | 51.85 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.03608501 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.26 |
| Ilogp | 4.19 |
| Xlogp3 | 5.11 |
| Wlogp | 4.81 |
| Mlogp | 3.86 |
| Silicos-it log p | 4.02 |
| Consensus log p | 4.4 |
| Esol log s | -5.48 |
| Esol solubility (mg/ml) | 0.0013 |
| Esol solubility (mol/l) | 0.00000332 |
| Esol class | Moderately |
| Ali log s | -5.94 |
| Ali solubility (mg/ml) | 0.000446 |
| Ali solubility (mol/l) | 0.00000114 |
| Ali class | Moderately |
| Silicos-it logsw | -6.98 |
| Silicos-it solubility (mg/ml) | 0.000041 |
| Silicos-it solubility (mol/l) | 0.0000001 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.06 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.02 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.471 |
| Logd | 4.135 |
| Logp | 4.891 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | 1.88E-05 |
| Ppb | 0.9792 |
| Vdss | 1.213 |
| Fu | 0.0246 |
| Cyp1a2-inh | 0.72 |
| Cyp1a2-sub | 0.822 |
| Cyp2c19-inh | 0.958 |
| Cyp2c19-sub | 0.633 |
| Cl | 4.679 |
| T12 | 0.201 |
| H-ht | 0.397 |
| Dili | 0.966 |
| Roa | 0.061 |
| Fdamdd | 0.77 |
| Skinsen | 0.201 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.029 |
| Bcf | 1.912 |
| Igc50 | 4.183 |
| Lc50 | 5.127 |
| Lc50dm | 4.576 |
| Nr-ar | 0.01 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.928 |
| Nr-aromatase | 0.965 |
| Nr-er | 0.493 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.152 |
| Sr-are | 0.807 |
| Sr-atad5 | 0.422 |
| Sr-hse | 0.288 |
| Sr-mmp | 0.669 |
| Sr-p53 | 0.914 |
| Vol | 373.619 |
| Dense | 1.044 |
| Flex | 0.412 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.614 |
| Synth | 2.487 |
| Fsp3 | 0.263 |
| Mce-18 | 18 |
| Natural product-likeness | -1.896 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |