| General Information | |
|---|---|
| ZINC ID | ZINC000066156680 |
| Molecular Weight (Da) | 453 |
| SMILES | CCCCCn1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)c(=O)cc1-c1cccc(Cl)c1 |
| Molecular Formula | C27Cl1N2O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 126.362 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| LogP | 6.527 |
| Activity (Ki) in nM | 51.2861 |
| Polar Surface Area (PSA) | 51.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.075 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.56 |
| Ilogp | 4.18 |
| Xlogp3 | 6.49 |
| Wlogp | 6.06 |
| Mlogp | 4.2 |
| Silicos-it log p | 6.08 |
| Consensus log p | 5.4 |
| Esol log s | -6.49 |
| Esol solubility (mg/ml) | 0.000148 |
| Esol solubility (mol/l) | 0.00000032 |
| Esol class | Poorly sol |
| Ali log s | -7.36 |
| Ali solubility (mg/ml) | 0.0000198 |
| Ali solubility (mol/l) | 4.38E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.18 |
| Silicos-it solubility (mg/ml) | 0.00000297 |
| Silicos-it solubility (mol/l) | 6.55E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.46 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.55 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.596 |
| Logd | 4.891 |
| Logp | 6.181 |
| F (20%) | 0.002 |
| F (30%) | 0.031 |
| Mdck | - |
| Ppb | 98.15% |
| Vdss | 0.606 |
| Fu | 1.11% |
| Cyp1a2-inh | 0.148 |
| Cyp1a2-sub | 0.167 |
| Cyp2c19-inh | 0.751 |
| Cyp2c19-sub | 0.067 |
| Cl | 2.646 |
| T12 | 0.013 |
| H-ht | 0.456 |
| Dili | 0.321 |
| Roa | 0.156 |
| Fdamdd | 0.636 |
| Skinsen | 0.106 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.389 |
| Bcf | 3.016 |
| Igc50 | 5.163 |
| Lc50 | 6.002 |
| Lc50dm | 6.384 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.589 |
| Nr-aromatase | 0.638 |
| Nr-er | 0.304 |
| Nr-er-lbd | 0.003 |
| Nr-ppar-gamma | 0.021 |
| Sr-are | 0.707 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.913 |
| Sr-mmp | 0.888 |
| Sr-p53 | 0.872 |
| Vol | 469.096 |
| Dense | 0.964 |
| Flex | 0.308 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.519 |
| Synth | 3.81 |
| Fsp3 | 0.556 |
| Mce-18 | 69.333 |
| Natural product-likeness | -0.765 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |