| General Information | |
|---|---|
| ZINC ID | ZINC000064746250 |
| Molecular Weight (Da) | 612 |
| SMILES | CC(C)(NS(=O)(=O)C(F)(F)F)C1CCN(S(=O)(=O)c2cc3ccccc3n2S(=O)(=O)c2ccccc2F)CC1 |
| Molecular Formula | C23F4N3O6S3 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 134.605 |
| HBA | 6 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| LogP | 5.37 |
| Activity (Ki) in nM | 169.824 |
| Polar Surface Area (PSA) | 147.76 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.22856772 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.39 |
| Ilogp | 3.04 |
| Xlogp3 | 4.49 |
| Wlogp | 8.18 |
| Mlogp | 2.8 |
| Silicos-it log p | 1.23 |
| Consensus log p | 3.95 |
| Esol log s | -6.22 |
| Esol solubility (mg/ml) | 3.71E-04 |
| Esol solubility (mol/l) | 6.06E-07 |
| Esol class | Poorly sol |
| Ali log s | -7.31 |
| Ali solubility (mg/ml) | 2.97E-05 |
| Ali solubility (mol/l) | 4.86E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.97 |
| Silicos-it solubility (mg/ml) | 6.60E-05 |
| Silicos-it solubility (mol/l) | 1.08E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.84 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 1 |
| Egan number of violations | 2 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.14 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.67 |
| Logd | 3.262 |
| Logp | 5.16 |
| F (20%) | 0.138 |
| F (30%) | 0.006 |
| Mdck | 8.99E-05 |
| Ppb | 0.9681 |
| Vdss | 0.348 |
| Fu | 0.0502 |
| Cyp1a2-inh | 0.18 |
| Cyp1a2-sub | 0.197 |
| Cyp2c19-inh | 0.711 |
| Cyp2c19-sub | 0.847 |
| Cl | 3.112 |
| T12 | 0.024 |
| H-ht | 0.957 |
| Dili | 0.995 |
| Roa | 0.037 |
| Fdamdd | 0.986 |
| Skinsen | 0.015 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.774 |
| Bcf | 0.959 |
| Igc50 | 3.38 |
| Lc50 | 4.414 |
| Lc50dm | 5.316 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.017 |
| Nr-ahr | 0.109 |
| Nr-aromatase | 0.735 |
| Nr-er | 0.106 |
| Nr-er-lbd | 0.01 |
| Nr-ppar-gamma | 0.027 |
| Sr-are | 0.807 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.01 |
| Sr-mmp | 0.844 |
| Sr-p53 | 0.004 |
| Vol | 519.212 |
| Dense | 1.177 |
| Flex | 28 |
| Nstereo | 0.286 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 2 |
| Synth | 0.407 |
| Fsp3 | 3.128 |
| Mce-18 | 0.391 |
| Natural product-likeness | 80.938 |
| Alarm nmr | -1.038 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Rejected |