| General Information | |
|---|---|
| ZINC ID | ZINC000059050237 |
| Molecular Weight (Da) | 438 |
| SMILES | CN(CCC(=O)NC1CC1)C(=O)c1ccc2c(c1)c1c(n2C)CC[C@@H](C2CCOCC2)C1 |
| Molecular Formula | C26N3O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 123.52 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| LogP | 3.021 |
| Activity (Ki) in nM | 660.693 |
| Polar Surface Area (PSA) | 63.57 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 0.56808453 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.62 |
| Ilogp | 3.77 |
| Xlogp3 | 2.81 |
| Wlogp | 3.39 |
| Mlogp | 2.64 |
| Silicos-it log p | 3.89 |
| Consensus log p | 3.3 |
| Esol log s | -4 |
| Esol solubility (mg/ml) | 0.0434 |
| Esol solubility (mol/l) | 0.0000992 |
| Esol class | Moderately |
| Ali log s | -3.8 |
| Ali solubility (mg/ml) | 0.069 |
| Ali solubility (mol/l) | 0.000158 |
| Ali class | Soluble |
| Silicos-it logsw | -5.59 |
| Silicos-it solubility (mg/ml) | 0.00112 |
| Silicos-it solubility (mol/l) | 0.00000256 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.97 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 1 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.904 |
| Logd | 2.564 |
| Logp | 2.48 |
| F (20%) | 0.263 |
| F (30%) | 0.989 |
| Mdck | - |
| Ppb | 51.53% |
| Vdss | 1.707 |
| Fu | 14.40% |
| Cyp1a2-inh | 0.07 |
| Cyp1a2-sub | 0.731 |
| Cyp2c19-inh | 0.558 |
| Cyp2c19-sub | 0.613 |
| Cl | 4.777 |
| T12 | 0.279 |
| H-ht | 0.891 |
| Dili | 0.219 |
| Roa | 0.979 |
| Fdamdd | 0.902 |
| Skinsen | 0.229 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.025 |
| Bcf | 0.3 |
| Igc50 | 2.271 |
| Lc50 | 3.245 |
| Lc50dm | 5.198 |
| Nr-ar | 0.34 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.194 |
| Nr-aromatase | 0.085 |
| Nr-er | 0.577 |
| Nr-er-lbd | 0.056 |
| Nr-ppar-gamma | 0.063 |
| Sr-are | 0.432 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.019 |
| Sr-mmp | 0.212 |
| Sr-p53 | 0.027 |
| Vol | 459.012 |
| Dense | 0.953 |
| Flex | 0.308 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.753 |
| Synth | 3.216 |
| Fsp3 | 0.615 |
| Mce-18 | 96.429 |
| Natural product-likeness | -0.896 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |