| General Information | |
|---|---|
| ZINC ID | ZINC000058592185 |
| Molecular Weight (Da) | 545 |
| SMILES | CC(C)(C)c1nnc(-c2nn(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)c2Cn2cncn2)s1 |
| Molecular Formula | C24Cl3N7S1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 147.919 |
| HBA | 5 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| LogP | 6.484 |
| Activity (Ki) in nM | 1148.154 |
| Polar Surface Area (PSA) | 102.55 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.972 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 27 |
| Fraction csp3 | 0.21 |
| Ilogp | 4.29 |
| Xlogp3 | 6.96 |
| Wlogp | 6.96 |
| Mlogp | 4.81 |
| Silicos-it log p | 6.55 |
| Consensus log p | 5.91 |
| Esol log s | -7.78 |
| Esol solubility (mg/ml) | 0.00000909 |
| Esol solubility (mol/l) | 1.67E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.93 |
| Ali solubility (mg/ml) | 0.00000064 |
| Ali solubility (mol/l) | 1.18E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.87 |
| Silicos-it solubility (mg/ml) | 7.28E-08 |
| Silicos-it solubility (mol/l) | 1.34E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.68 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.12 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.022 |
| Logd | 5.575 |
| Logp | 5.841 |
| F (20%) | 0.001 |
| F (30%) | 0.018 |
| Mdck | 2.39E-05 |
| Ppb | 0.9873 |
| Vdss | 2.796 |
| Fu | 0.0249 |
| Cyp1a2-inh | 0.275 |
| Cyp1a2-sub | 0.185 |
| Cyp2c19-inh | 0.909 |
| Cyp2c19-sub | 0.084 |
| Cl | 3.928 |
| T12 | 0.03 |
| H-ht | 0.324 |
| Dili | 0.994 |
| Roa | 0.259 |
| Fdamdd | 0.255 |
| Skinsen | 0.131 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.278 |
| Bcf | 2.414 |
| Igc50 | 4.66 |
| Lc50 | 6.474 |
| Lc50dm | 4.734 |
| Nr-ar | 0.017 |
| Nr-ar-lbd | 0.332 |
| Nr-ahr | 0.889 |
| Nr-aromatase | 0.996 |
| Nr-er | 0.896 |
| Nr-er-lbd | 0.8 |
| Nr-ppar-gamma | 0.951 |
| Sr-are | 0.956 |
| Sr-atad5 | 0.127 |
| Sr-hse | 0.268 |
| Sr-mmp | 0.979 |
| Sr-p53 | 0.922 |
| Vol | 490.36 |
| Dense | 1.107 |
| Flex | 0.222 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.239 |
| Synth | 2.925 |
| Fsp3 | 0.208 |
| Mce-18 | 30 |
| Natural product-likeness | -1.738 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |