| General Information | |
|---|---|
| ZINC ID | ZINC000058581290 |
| Molecular Weight (Da) | 497 |
| SMILES | CCCCCn1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)c(=O)c2cc(CCc3ccccc3)ccc21 |
| Molecular Formula | C33N2O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 147.21 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| LogP | 7.684 |
| Activity (Ki) in nM | 56.234 |
| Polar Surface Area (PSA) | 51.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.03686881 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.52 |
| Ilogp | 5.46 |
| Xlogp3 | 7.87 |
| Wlogp | 6.68 |
| Mlogp | 4.97 |
| Silicos-it log p | 7.29 |
| Consensus log p | 6.45 |
| Esol log s | -7.54 |
| Esol solubility (mg/ml) | 1.44E-05 |
| Esol solubility (mol/l) | 2.90E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.79 |
| Ali solubility (mg/ml) | 8.04E-07 |
| Ali solubility (mol/l) | 1.62E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.01 |
| Silicos-it solubility (mg/ml) | 4.89E-08 |
| Silicos-it solubility (mol/l) | 9.84E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.74 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 4 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.77 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.935 |
| Logd | 5.203 |
| Logp | 6.949 |
| F (20%) | 0.024 |
| F (30%) | 0.868 |
| Mdck | 2.05E-05 |
| Ppb | 0.9823 |
| Vdss | 1.309 |
| Fu | 0.0062 |
| Cyp1a2-inh | 0.116 |
| Cyp1a2-sub | 0.173 |
| Cyp2c19-inh | 0.701 |
| Cyp2c19-sub | 0.07 |
| Cl | 2.684 |
| T12 | 0.008 |
| H-ht | 0.563 |
| Dili | 0.073 |
| Roa | 0.145 |
| Fdamdd | 0.792 |
| Skinsen | 0.392 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.616 |
| Bcf | 2.445 |
| Igc50 | 5.369 |
| Lc50 | 5.972 |
| Lc50dm | 6.474 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.716 |
| Nr-aromatase | 0.593 |
| Nr-er | 0.347 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.079 |
| Sr-are | 0.771 |
| Sr-atad5 | 0.009 |
| Sr-hse | 0.899 |
| Sr-mmp | 0.838 |
| Sr-p53 | 0.821 |
| Vol | 543.831 |
| Dense | 0.913 |
| Flex | 31 |
| Nstereo | 0.323 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 2 |
| Synth | 0.336 |
| Fsp3 | 3.661 |
| Mce-18 | 0.515 |
| Natural product-likeness | 76.8 |
| Alarm nmr | -0.768 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |