| General Information | |
|---|---|
| ZINC ID | ZINC000058506429 |
| Molecular Weight (Da) | 367 |
| SMILES | CN1CCN(C(=O)c2cn3c4c(cccc24)OC[C@H]3C2CCCCC2)CC1 |
| Molecular Formula | C22N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 104.256 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| LogP | 3.493 |
| Activity (Ki) in nM | 100 |
| Polar Surface Area (PSA) | 37.71 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.75899577 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.59 |
| Ilogp | 3.5 |
| Xlogp3 | 3.36 |
| Wlogp | 2.78 |
| Mlogp | 2.56 |
| Silicos-it log p | 2.61 |
| Consensus log p | 2.96 |
| Esol log s | -4.28 |
| Esol solubility (mg/ml) | 0.0191 |
| Esol solubility (mol/l) | 0.000052 |
| Esol class | Moderately |
| Ali log s | -3.83 |
| Ali solubility (mg/ml) | 0.0544 |
| Ali solubility (mol/l) | 0.000148 |
| Ali class | Soluble |
| Silicos-it logsw | -4.02 |
| Silicos-it solubility (mg/ml) | 0.035 |
| Silicos-it solubility (mol/l) | 0.0000953 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.16 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.78 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.381 |
| Logd | 3.828 |
| Logp | 4.197 |
| F (20%) | 0.98 |
| F (30%) | 0.491 |
| Mdck | - |
| Ppb | 84.45% |
| Vdss | 1.972 |
| Fu | 10.66% |
| Cyp1a2-inh | 0.202 |
| Cyp1a2-sub | 0.935 |
| Cyp2c19-inh | 0.615 |
| Cyp2c19-sub | 0.949 |
| Cl | 5.395 |
| T12 | 0.031 |
| H-ht | 0.97 |
| Dili | 0.915 |
| Roa | 0.464 |
| Fdamdd | 0.519 |
| Skinsen | 0.619 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.914 |
| Bcf | 1.293 |
| Igc50 | 4.216 |
| Lc50 | 4.556 |
| Lc50dm | 3.964 |
| Nr-ar | 0.488 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.094 |
| Nr-aromatase | 0.022 |
| Nr-er | 0.255 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.005 |
| Sr-are | 0.481 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.015 |
| Sr-mmp | 0.039 |
| Sr-p53 | 0.037 |
| Vol | 383.674 |
| Dense | 0.957 |
| Flex | 0.111 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.815 |
| Synth | 3.003 |
| Fsp3 | 0.591 |
| Mce-18 | 92.143 |
| Natural product-likeness | -0.588 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |