| General Information | |
|---|---|
| ZINC ID | ZINC000049881521 |
| Molecular Weight (Da) | 554 |
| SMILES | Cc1c(C(=O)NN2C[C@H]3CCC[C@H]3C2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C#CC2CCCC2)s1 |
| Molecular Formula | C29Cl2N4O1S1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 144.706 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| LogP | 8.764 |
| Activity (Ki) in nM | 912.011 |
| Polar Surface Area (PSA) | 78.4 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.085 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.45 |
| Ilogp | 5.24 |
| Xlogp3 | 8.47 |
| Wlogp | 6.83 |
| Mlogp | 5.96 |
| Silicos-it log p | 7 |
| Consensus log p | 6.7 |
| Esol log s | -8.6 |
| Esol solubility (mg/ml) | 0.0000014 |
| Esol solubility (mol/l) | 2.52E-09 |
| Esol class | Poorly sol |
| Ali log s | -9.99 |
| Ali solubility (mg/ml) | 0.00000005 |
| Ali solubility (mol/l) | 1.03E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.14 |
| Silicos-it solubility (mg/ml) | 0.00000396 |
| Silicos-it solubility (mol/l) | 7.16E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.66 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.24 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.436 |
| Logd | 5.507 |
| Logp | 7.503 |
| F (20%) | 0.004 |
| F (30%) | 0.069 |
| Mdck | 6.10E-06 |
| Ppb | 1.0214 |
| Vdss | 2.495 |
| Fu | 0.0073 |
| Cyp1a2-inh | 0.099 |
| Cyp1a2-sub | 0.874 |
| Cyp2c19-inh | 0.89 |
| Cyp2c19-sub | 0.862 |
| Cl | 4.508 |
| T12 | 0.003 |
| H-ht | 0.997 |
| Dili | 0.984 |
| Roa | 0.728 |
| Fdamdd | 0.509 |
| Skinsen | 0.813 |
| Ec | 0.003 |
| Ei | 0.015 |
| Respiratory | 0.546 |
| Bcf | 1.422 |
| Igc50 | 5.472 |
| Lc50 | 6.258 |
| Lc50dm | 6.262 |
| Nr-ar | 0.004 |
| Nr-ar-lbd | 0.771 |
| Nr-ahr | 0.971 |
| Nr-aromatase | 0.956 |
| Nr-er | 0.887 |
| Nr-er-lbd | 0.24 |
| Nr-ppar-gamma | 0.951 |
| Sr-are | 0.977 |
| Sr-atad5 | 0.8 |
| Sr-hse | 0.875 |
| Sr-mmp | 0.988 |
| Sr-p53 | 0.994 |
| Vol | 534.145 |
| Dense | 1.034 |
| Flex | 0.156 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 5 |
| Qed | 0.35 |
| Synth | 3.936 |
| Fsp3 | 0.448 |
| Mce-18 | 114.286 |
| Natural product-likeness | -0.689 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |