| General Information | |
|---|---|
| ZINC ID | ZINC000049877576 |
| Molecular Weight (Da) | 590 |
| SMILES | Nc1nnc(-c2cc(C(F)(F)F)cc(S(=O)(=O)N3CCN(C(=O)[C@@H]4C[C@H]4c4ccc(C(F)(F)F)cc4)CC3)c2)o1 |
| Molecular Formula | C24F6N5O4S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 132.034 |
| HBA | 6 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| LogP | 3.184 |
| Activity (Ki) in nM | 398.107 |
| Polar Surface Area (PSA) | 131.01 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.89762687 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.38 |
| Ilogp | 3.56 |
| Xlogp3 | 3.1 |
| Wlogp | 6.62 |
| Mlogp | 3.11 |
| Silicos-it log p | 3.05 |
| Consensus log p | 3.89 |
| Esol log s | -5.23 |
| Esol solubility (mg/ml) | 0.00344 |
| Esol solubility (mol/l) | 0.00000583 |
| Esol class | Moderately |
| Ali log s | -5.52 |
| Ali solubility (mg/ml) | 0.00178 |
| Ali solubility (mol/l) | 0.00000302 |
| Ali class | Moderately |
| Silicos-it logsw | -7.05 |
| Silicos-it solubility (mg/ml) | 0.0000524 |
| Silicos-it solubility (mol/l) | 8.89E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -7.7 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.64 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.729 |
| Logd | 4.001 |
| Logp | 3.989 |
| F (20%) | 0.002 |
| F (30%) | 0.003 |
| Mdck | - |
| Ppb | 97.99% |
| Vdss | 2.81 |
| Fu | 2.22% |
| Cyp1a2-inh | 0.113 |
| Cyp1a2-sub | 0.256 |
| Cyp2c19-inh | 0.808 |
| Cyp2c19-sub | 0.06 |
| Cl | 2.18 |
| T12 | 0.032 |
| H-ht | 0.996 |
| Dili | 0.986 |
| Roa | 0.85 |
| Fdamdd | 0.843 |
| Skinsen | 0.031 |
| Ec | 0.003 |
| Ei | 0.006 |
| Respiratory | 0.905 |
| Bcf | 0.954 |
| Igc50 | 3.548 |
| Lc50 | 4.679 |
| Lc50dm | 5.707 |
| Nr-ar | 0.012 |
| Nr-ar-lbd | 0.037 |
| Nr-ahr | 0.201 |
| Nr-aromatase | 0.738 |
| Nr-er | 0.56 |
| Nr-er-lbd | 0.029 |
| Nr-ppar-gamma | 0.12 |
| Sr-are | 0.893 |
| Sr-atad5 | 0.009 |
| Sr-hse | 0.009 |
| Sr-mmp | 0.551 |
| Sr-p53 | 0.35 |
| Vol | 502.209 |
| Dense | 1.173 |
| Flex | 0.267 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.438 |
| Synth | 3.793 |
| Fsp3 | 0.375 |
| Mce-18 | 123.273 |
| Natural product-likeness | -1.334 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |