| General Information | |
|---|---|
| ZINC ID | ZINC000049877468 |
| Molecular Weight (Da) | 545 |
| SMILES | CC(C)(C)c1nnc(-c2nn(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)c2CN2CCCC2=O)o1 |
| Molecular Formula | C26Cl3N5O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 143.093 |
| HBA | 5 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| LogP | 6.649 |
| Activity (Ki) in nM | 93.3254 |
| Polar Surface Area (PSA) | 77.05 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.89573675 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.31 |
| Ilogp | 4.96 |
| Xlogp3 | 6.03 |
| Wlogp | 6.44 |
| Mlogp | 4.9 |
| Silicos-it log p | 6.42 |
| Consensus log p | 5.75 |
| Esol log s | -7.07 |
| Esol solubility (mg/ml) | 0.000046 |
| Esol solubility (mol/l) | 8.45E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.43 |
| Ali solubility (mg/ml) | 0.0000204 |
| Ali solubility (mol/l) | 3.74E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10 |
| Silicos-it solubility (mg/ml) | 0.00000005 |
| Silicos-it solubility (mol/l) | 1.01E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.34 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.99 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.152 |
| Logd | 4.718 |
| Logp | 5.579 |
| F (20%) | 0.001 |
| F (30%) | 0.003 |
| Mdck | - |
| Ppb | 96.83% |
| Vdss | 0.602 |
| Fu | 2.30% |
| Cyp1a2-inh | 0.18 |
| Cyp1a2-sub | 0.803 |
| Cyp2c19-inh | 0.892 |
| Cyp2c19-sub | 0.068 |
| Cl | 3.738 |
| T12 | 0.023 |
| H-ht | 0.436 |
| Dili | 0.968 |
| Roa | 0.856 |
| Fdamdd | 0.177 |
| Skinsen | 0.053 |
| Ec | 0.003 |
| Ei | 0.006 |
| Respiratory | 0.573 |
| Bcf | 2.352 |
| Igc50 | 4.678 |
| Lc50 | 5.661 |
| Lc50dm | 5.023 |
| Nr-ar | 0.005 |
| Nr-ar-lbd | 0.179 |
| Nr-ahr | 0.408 |
| Nr-aromatase | 0.964 |
| Nr-er | 0.875 |
| Nr-er-lbd | 0.343 |
| Nr-ppar-gamma | 0.925 |
| Sr-are | 0.923 |
| Sr-atad5 | 0.019 |
| Sr-hse | 0.251 |
| Sr-mmp | 0.932 |
| Sr-p53 | 0.92 |
| Vol | 504.666 |
| Dense | 1.076 |
| Flex | 0.214 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.271 |
| Synth | 2.841 |
| Fsp3 | 0.308 |
| Mce-18 | 67.471 |
| Natural product-likeness | -1.295 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |