| General Information | |
|---|---|
| ZINC ID | ZINC000049762299 |
| Molecular Weight (Da) | 531 |
| SMILES | CN1CCN(C(=O)c2nn(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)c2Cn2cncn2)CC1 |
| Molecular Formula | C24Cl3N7O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 142.217 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| LogP | 4.191 |
| Activity (Ki) in nM | 1412.54 |
| Polar Surface Area (PSA) | 72.08 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.0209335 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.25 |
| Ilogp | 3.76 |
| Xlogp3 | 4.72 |
| Wlogp | 3.77 |
| Mlogp | 3.72 |
| Silicos-it log p | 3.58 |
| Consensus log p | 3.91 |
| Esol log s | -6.17 |
| Esol solubility (mg/ml) | 0.000356 |
| Esol solubility (mol/l) | 0.00000067 |
| Esol class | Poorly sol |
| Ali log s | -5.96 |
| Ali solubility (mg/ml) | 0.000578 |
| Ali solubility (mol/l) | 0.00000109 |
| Ali class | Moderately |
| Silicos-it logsw | -7.76 |
| Silicos-it solubility (mg/ml) | 0.00000927 |
| Silicos-it solubility (mol/l) | 1.75E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.19 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.68 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.781 |
| Logd | 3.877 |
| Logp | 3.664 |
| F (20%) | 0.003 |
| F (30%) | 0.004 |
| Mdck | - |
| Ppb | 93.75% |
| Vdss | 1.715 |
| Fu | 5.86% |
| Cyp1a2-inh | 0.313 |
| Cyp1a2-sub | 0.756 |
| Cyp2c19-inh | 0.905 |
| Cyp2c19-sub | 0.8 |
| Cl | 8.062 |
| T12 | 0.097 |
| H-ht | 0.453 |
| Dili | 0.982 |
| Roa | 0.443 |
| Fdamdd | 0.393 |
| Skinsen | 0.599 |
| Ec | 0.003 |
| Ei | 0.006 |
| Respiratory | 0.053 |
| Bcf | 1.776 |
| Igc50 | 3.392 |
| Lc50 | 5.233 |
| Lc50dm | 3.845 |
| Nr-ar | 0.027 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.852 |
| Nr-aromatase | 0.923 |
| Nr-er | 0.129 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.009 |
| Sr-are | 0.78 |
| Sr-atad5 | 0.02 |
| Sr-hse | 0.011 |
| Sr-mmp | 0.206 |
| Sr-p53 | 0.589 |
| Vol | 483.278 |
| Dense | 1.095 |
| Flex | 0.207 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.379 |
| Synth | 2.644 |
| Fsp3 | 0.25 |
| Mce-18 | 63.467 |
| Natural product-likeness | -1.761 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |