| General Information | |
|---|---|
| ZINC ID | ZINC000049757531 |
| Molecular Weight (Da) | 574 |
| SMILES | O=C(N[C@@H]1C[C@@H]1c1ccccc1)c1nn(-c2ccccc2Cl)c(-c2ccc(Br)cc2)c1Cn1cncn1 |
| Molecular Formula | C28Br1Cl1N6O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 151.061 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| LogP | 5.288 |
| Activity (Ki) in nM | 3235.937 |
| Polar Surface Area (PSA) | 77.63 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.204 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 28 |
| Fraction csp3 | 0.14 |
| Ilogp | 4.21 |
| Xlogp3 | 6.11 |
| Wlogp | 5.88 |
| Mlogp | 4.71 |
| Silicos-it log p | 4.75 |
| Consensus log p | 5.13 |
| Esol log s | -7.28 |
| Esol solubility (mg/ml) | 0.0000302 |
| Esol solubility (mol/l) | 5.26E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.52 |
| Ali solubility (mg/ml) | 0.0000173 |
| Ali solubility (mol/l) | 3.01E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.09 |
| Silicos-it solubility (mg/ml) | 4.64E-08 |
| Silicos-it solubility (mol/l) | 8.09E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.46 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.4 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.654 |
| Logd | 4.846 |
| Logp | 5.896 |
| F (20%) | 0.002 |
| F (30%) | 0.001 |
| Mdck | 2.10E-05 |
| Ppb | 0.9755 |
| Vdss | 2.28 |
| Fu | 0.0176 |
| Cyp1a2-inh | 0.246 |
| Cyp1a2-sub | 0.076 |
| Cyp2c19-inh | 0.915 |
| Cyp2c19-sub | 0.083 |
| Cl | 4.367 |
| T12 | 0.058 |
| H-ht | 0.275 |
| Dili | 0.994 |
| Roa | 0.879 |
| Fdamdd | 0.691 |
| Skinsen | 0.546 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.195 |
| Bcf | 1.767 |
| Igc50 | 4.704 |
| Lc50 | 6.796 |
| Lc50dm | 4.375 |
| Nr-ar | 0.031 |
| Nr-ar-lbd | 0.014 |
| Nr-ahr | 0.908 |
| Nr-aromatase | 0.984 |
| Nr-er | 0.324 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.611 |
| Sr-are | 0.792 |
| Sr-atad5 | 0.112 |
| Sr-hse | 0.371 |
| Sr-mmp | 0.871 |
| Sr-p53 | 0.779 |
| Vol | 513.86 |
| Dense | 1.113 |
| Flex | 0.25 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 3 |
| Qed | 0.264 |
| Synth | 3.378 |
| Fsp3 | 0.143 |
| Mce-18 | 98.812 |
| Natural product-likeness | -1.52 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |