| General Information | |
|---|---|
| ZINC ID | ZINC000049694541 |
| Molecular Weight (Da) | 559 |
| SMILES | CN(C)CCCN/C(=NS(=O)(=O)c1ccc(Cl)cc1)N1C[C@H](c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| Molecular Formula | C27Cl2N5O2S1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 150.531 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| LogP | 5.572 |
| Activity (Ki) in nM | 3.0903 |
| Polar Surface Area (PSA) | 85.75 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.878 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.26 |
| Ilogp | 4.56 |
| Xlogp3 | 5.76 |
| Wlogp | 5.4 |
| Mlogp | 4.29 |
| Silicos-it log p | 4.96 |
| Consensus log p | 5 |
| Esol log s | -6.63 |
| Esol solubility (mg/ml) | 0.00013 |
| Esol solubility (mol/l) | 0.00000023 |
| Esol class | Poorly sol |
| Ali log s | -7.33 |
| Ali solubility (mg/ml) | 0.0000262 |
| Ali solubility (mol/l) | 4.69E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.78 |
| Silicos-it solubility (mg/ml) | 9.29E-08 |
| Silicos-it solubility (mol/l) | 1.66E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.62 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.98 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.911 |
| Logd | 2.617 |
| Logp | 4.67 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 96.89% |
| Vdss | 3.007 |
| Fu | 5.55% |
| Cyp1a2-inh | 0.141 |
| Cyp1a2-sub | 0.948 |
| Cyp2c19-inh | 0.494 |
| Cyp2c19-sub | 0.983 |
| Cl | 0.778 |
| T12 | 0.019 |
| H-ht | 0.638 |
| Dili | 0.98 |
| Roa | 0.491 |
| Fdamdd | 0.896 |
| Skinsen | 0.108 |
| Ec | 0.003 |
| Ei | 0.004 |
| Respiratory | 0.852 |
| Bcf | 0.904 |
| Igc50 | 4.66 |
| Lc50 | 5.34 |
| Lc50dm | 4.978 |
| Nr-ar | 0.008 |
| Nr-ar-lbd | 0.013 |
| Nr-ahr | 0.053 |
| Nr-aromatase | 0.059 |
| Nr-er | 0.261 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.02 |
| Sr-are | 0.429 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.003 |
| Sr-mmp | 0.889 |
| Sr-p53 | 0.101 |
| Vol | 533.817 |
| Dense | 1.044 |
| Flex | 0.385 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.238 |
| Synth | 3.179 |
| Fsp3 | 0.259 |
| Mce-18 | 77.941 |
| Natural product-likeness | -0.772 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |