| General Information | |
|---|---|
| ZINC ID | ZINC000049573636 |
| Molecular Weight (Da) | 368 |
| SMILES | CSC(=O)N1CC2(CCCCC2)CN/C1=Nc1cccc2ccccc12 |
| Molecular Formula | C21N3O1S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 107.407 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| LogP | 5.036 |
| Activity (Ki) in nM | 154.882 |
| Polar Surface Area (PSA) | 70 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.97732865 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 10 |
| Fraction csp3 | 0.43 |
| Ilogp | 3.21 |
| Xlogp3 | 5.37 |
| Wlogp | 4.4 |
| Mlogp | 4.14 |
| Silicos-it log p | 4.1 |
| Consensus log p | 4.24 |
| Esol log s | -5.59 |
| Esol solubility (mg/ml) | 0.000948 |
| Esol solubility (mol/l) | 0.00000258 |
| Esol class | Moderately |
| Ali log s | -6.59 |
| Ali solubility (mg/ml) | 0.0000937 |
| Ali solubility (mol/l) | 0.00000025 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.37 |
| Silicos-it solubility (mg/ml) | 0.000155 |
| Silicos-it solubility (mol/l) | 0.00000042 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.73 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.17 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.758 |
| Logd | 4.433 |
| Logp | 5.452 |
| F (20%) | 0.003 |
| F (30%) | 0.005 |
| Mdck | 2.62E-05 |
| Ppb | 0.9663 |
| Vdss | 1.041 |
| Fu | 0.0246 |
| Cyp1a2-inh | 0.521 |
| Cyp1a2-sub | 0.807 |
| Cyp2c19-inh | 0.486 |
| Cyp2c19-sub | 0.668 |
| Cl | 7.957 |
| T12 | 0.02 |
| H-ht | 0.876 |
| Dili | 0.773 |
| Roa | 0.986 |
| Fdamdd | 0.879 |
| Skinsen | 0.766 |
| Ec | 0.004 |
| Ei | 0.035 |
| Respiratory | 0.985 |
| Bcf | 2.294 |
| Igc50 | 4.276 |
| Lc50 | 4.947 |
| Lc50dm | 6.166 |
| Nr-ar | 0.155 |
| Nr-ar-lbd | 0.014 |
| Nr-ahr | 0.924 |
| Nr-aromatase | 0.939 |
| Nr-er | 0.473 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.024 |
| Sr-are | 0.714 |
| Sr-atad5 | 0.027 |
| Sr-hse | 0.417 |
| Sr-mmp | 0.933 |
| Sr-p53 | 0.711 |
| Vol | 379.381 |
| Dense | 0.968 |
| Flex | 0.167 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 3 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.738 |
| Synth | 3.394 |
| Fsp3 | 0.429 |
| Mce-18 | 74.2 |
| Natural product-likeness | -0.366 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |