| General Information | |
|---|---|
| ZINC ID | ZINC000049070476 |
| Molecular Weight (Da) | 460 |
| SMILES | Cc1ccc([C@@H](c2ccc(Cl)cc2Cl)N2CCN(C(=O)NC3CCCCC3)CC2)cc1 |
| Molecular Formula | C25Cl2N3O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 128.84 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| LogP | 7.121 |
| Activity (Ki) in nM | 229.087 |
| Polar Surface Area (PSA) | 35.58 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.12 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.48 |
| Ilogp | 4.63 |
| Xlogp3 | 5.98 |
| Wlogp | 4.97 |
| Mlogp | 4.89 |
| Silicos-it log p | 5.18 |
| Consensus log p | 5.13 |
| Esol log s | -6.35 |
| Esol solubility (mg/ml) | 0.000204 |
| Esol solubility (mol/l) | 0.00000044 |
| Esol class | Poorly sol |
| Ali log s | -6.5 |
| Ali solubility (mg/ml) | 0.000144 |
| Ali solubility (mol/l) | 0.00000031 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.67 |
| Silicos-it solubility (mg/ml) | 0.00000996 |
| Silicos-it solubility (mol/l) | 2.16E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.86 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.71 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.223 |
| Logd | 4.654 |
| Logp | 5.876 |
| F (20%) | 0.008 |
| F (30%) | 0.007 |
| Mdck | 7.24E-06 |
| Ppb | 0.9775 |
| Vdss | 1.669 |
| Fu | 0.0136 |
| Cyp1a2-inh | 0.137 |
| Cyp1a2-sub | 0.946 |
| Cyp2c19-inh | 0.866 |
| Cyp2c19-sub | 0.909 |
| Cl | 5.738 |
| T12 | 0.013 |
| H-ht | 0.949 |
| Dili | 0.769 |
| Roa | 0.138 |
| Fdamdd | 0.877 |
| Skinsen | 0.063 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.68 |
| Bcf | 1.082 |
| Igc50 | 4.811 |
| Lc50 | 6.186 |
| Lc50dm | 3.943 |
| Nr-ar | 0.028 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.091 |
| Nr-aromatase | 0.595 |
| Nr-er | 0.371 |
| Nr-er-lbd | 0.03 |
| Nr-ppar-gamma | 0.005 |
| Sr-are | 0.662 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.119 |
| Sr-mmp | 0.683 |
| Sr-p53 | 0.765 |
| Vol | 460.478 |
| Dense | 0.997 |
| Flex | 0.24 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.603 |
| Synth | 2.665 |
| Fsp3 | 0.48 |
| Mce-18 | 77.892 |
| Natural product-likeness | -1.466 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |