| General Information | |
|---|---|
| ZINC ID | ZINC000049053911 |
| Molecular Weight (Da) | 412 |
| SMILES | CC(C)[C@@H]1CC(=O)c2cc(-c3ccc(Cl)cc3)c(-c3ccccc3Cl)nc2O1 |
| Molecular Formula | C23Cl2N1O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 112.145 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| LogP | 6.893 |
| Activity (Ki) in nM | 3.2359 |
| Polar Surface Area (PSA) | 39.19 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.999 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.22 |
| Ilogp | 3.85 |
| Xlogp3 | 6.58 |
| Wlogp | 6.71 |
| Mlogp | 4.57 |
| Silicos-it log p | 6.88 |
| Consensus log p | 5.72 |
| Esol log s | -6.82 |
| Esol solubility (mg/ml) | 0.0000625 |
| Esol solubility (mol/l) | 0.00000015 |
| Esol class | Poorly sol |
| Ali log s | -7.2 |
| Ali solubility (mg/ml) | 0.0000259 |
| Ali solubility (mol/l) | 6.28E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.25 |
| Silicos-it solubility (mg/ml) | 0.00000023 |
| Silicos-it solubility (mol/l) | 5.58E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.14 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.87 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.57 |
| Logd | 4.467 |
| Logp | 6.609 |
| F (20%) | 0.003 |
| F (30%) | 0.011 |
| Mdck | - |
| Ppb | 100.19% |
| Vdss | 0.762 |
| Fu | 1.14% |
| Cyp1a2-inh | 0.456 |
| Cyp1a2-sub | 0.251 |
| Cyp2c19-inh | 0.795 |
| Cyp2c19-sub | 0.065 |
| Cl | 5.511 |
| T12 | 0.019 |
| H-ht | 0.336 |
| Dili | 0.96 |
| Roa | 0.662 |
| Fdamdd | 0.213 |
| Skinsen | 0.026 |
| Ec | 0.003 |
| Ei | 0.164 |
| Respiratory | 0.146 |
| Bcf | 3.833 |
| Igc50 | 5.381 |
| Lc50 | 7.981 |
| Lc50dm | 6.838 |
| Nr-ar | 0.072 |
| Nr-ar-lbd | 0.184 |
| Nr-ahr | 0.916 |
| Nr-aromatase | 0.625 |
| Nr-er | 0.71 |
| Nr-er-lbd | 0.851 |
| Nr-ppar-gamma | 0.078 |
| Sr-are | 0.902 |
| Sr-atad5 | 0.687 |
| Sr-hse | 0.661 |
| Sr-mmp | 0.885 |
| Sr-p53 | 0.872 |
| Vol | 404.773 |
| Dense | 1.016 |
| Flex | 0.125 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.48 |
| Synth | 2.993 |
| Fsp3 | 0.217 |
| Mce-18 | 72.286 |
| Natural product-likeness | -0.12 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |