| General Information | |
|---|---|
| ZINC ID | ZINC000045495026 |
| Molecular Weight (Da) | 497 |
| SMILES | Cc1c(-c2nnc(Cc3ccccn3)o2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C24Cl3N5O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 130.819 |
| HBA | 5 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| LogP | 6.978 |
| Activity (Ki) in nM | 52.4807 |
| Polar Surface Area (PSA) | 69.63 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.926 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 28 |
| Fraction csp3 | 0.08 |
| Ilogp | 3.89 |
| Xlogp3 | 6.25 |
| Wlogp | 6.84 |
| Mlogp | 4.76 |
| Silicos-it log p | 6.55 |
| Consensus log p | 5.66 |
| Esol log s | -7.16 |
| Esol solubility (mg/ml) | 0.0000347 |
| Esol solubility (mol/l) | 6.99E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.5 |
| Ali solubility (mg/ml) | 0.0000157 |
| Ali solubility (mol/l) | 3.17E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -11.04 |
| Silicos-it solubility (mg/ml) | 4.53E-09 |
| Silicos-it solubility (mol/l) | 9.12E-12 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.89 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.64 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.013 |
| Logd | 4.659 |
| Logp | 5.496 |
| F (20%) | 0.001 |
| F (30%) | 0.003 |
| Mdck | - |
| Ppb | 98.41% |
| Vdss | 3.476 |
| Fu | 1.91% |
| Cyp1a2-inh | 0.247 |
| Cyp1a2-sub | 0.33 |
| Cyp2c19-inh | 0.916 |
| Cyp2c19-sub | 0.123 |
| Cl | 3.532 |
| T12 | 0.065 |
| H-ht | 0.431 |
| Dili | 0.985 |
| Roa | 0.714 |
| Fdamdd | 0.283 |
| Skinsen | 0.039 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.951 |
| Bcf | 2.799 |
| Igc50 | 5.079 |
| Lc50 | 6.615 |
| Lc50dm | 5.256 |
| Nr-ar | 0.004 |
| Nr-ar-lbd | 0.307 |
| Nr-ahr | 0.412 |
| Nr-aromatase | 0.941 |
| Nr-er | 0.882 |
| Nr-er-lbd | 0.436 |
| Nr-ppar-gamma | 0.412 |
| Sr-are | 0.968 |
| Sr-atad5 | 0.32 |
| Sr-hse | 0.124 |
| Sr-mmp | 0.911 |
| Sr-p53 | 0.924 |
| Vol | 456.011 |
| Dense | 1.086 |
| Flex | 0.179 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.266 |
| Synth | 2.565 |
| Fsp3 | 0.083 |
| Mce-18 | 27 |
| Natural product-likeness | -1.768 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |