| General Information | |
|---|---|
| ZINC ID | ZINC000045484799 |
| Molecular Weight (Da) | 494 |
| SMILES | C[C@@H](F)c1c(-c2nnc(C(C)(C)C)o2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C23Cl3F1N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 126.926 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| LogP | 7.774 |
| Activity (Ki) in nM | 933.254 |
| Polar Surface Area (PSA) | 56.74 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.899 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.26 |
| Ilogp | 4.36 |
| Xlogp3 | 7.22 |
| Wlogp | 7.97 |
| Mlogp | 5.68 |
| Silicos-it log p | 7.07 |
| Consensus log p | 6.46 |
| Esol log s | -7.63 |
| Esol solubility (mg/ml) | 0.0000116 |
| Esol solubility (mol/l) | 2.35E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.23 |
| Ali solubility (mg/ml) | 0.00000287 |
| Ali solubility (mol/l) | 5.82E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.03 |
| Silicos-it solubility (mg/ml) | 4.59E-08 |
| Silicos-it solubility (mol/l) | 9.29E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.19 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.34 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.208 |
| Logd | 5.147 |
| Logp | 6.343 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | 7.92E-06 |
| Ppb | 0.9849 |
| Vdss | 4.456 |
| Fu | 0.0218 |
| Cyp1a2-inh | 0.269 |
| Cyp1a2-sub | 0.8 |
| Cyp2c19-inh | 0.849 |
| Cyp2c19-sub | 0.093 |
| Cl | 2.371 |
| T12 | 0.02 |
| H-ht | 0.382 |
| Dili | 0.984 |
| Roa | 0.125 |
| Fdamdd | 0.925 |
| Skinsen | 0.046 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.668 |
| Bcf | 3.201 |
| Igc50 | 5.208 |
| Lc50 | 7.14 |
| Lc50dm | 5.93 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.102 |
| Nr-ahr | 0.125 |
| Nr-aromatase | 0.977 |
| Nr-er | 0.709 |
| Nr-er-lbd | 0.015 |
| Nr-ppar-gamma | 0.397 |
| Sr-are | 0.915 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.018 |
| Sr-mmp | 0.945 |
| Sr-p53 | 0.829 |
| Vol | 450.252 |
| Dense | 1.093 |
| Flex | 0.227 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 3 |
| Toxicophores | 1 |
| Qed | 0.29 |
| Synth | 3.271 |
| Fsp3 | 0.261 |
| Mce-18 | 54 |
| Natural product-likeness | -1.371 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 3 |
| Gsk | Rejected |
| Goldentriangle | Rejected |