| General Information | |
|---|---|
| ZINC ID | ZINC000045484701 |
| Molecular Weight (Da) | 484 |
| SMILES | Cc1c(-c2nnc(-c3cnccn3)o2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C22Cl3N6O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 124.21 |
| HBA | 6 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| LogP | 5.792 |
| Activity (Ki) in nM | 194.984 |
| Polar Surface Area (PSA) | 82.52 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.89956206 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 28 |
| Fraction csp3 | 0.05 |
| Ilogp | 3.42 |
| Xlogp3 | 4.89 |
| Wlogp | 6.31 |
| Mlogp | 3.82 |
| Silicos-it log p | 5.59 |
| Consensus log p | 4.81 |
| Esol log s | -6.3 |
| Esol solubility (mg/ml) | 0.000241 |
| Esol solubility (mol/l) | 0.00000049 |
| Esol class | Poorly sol |
| Ali log s | -6.36 |
| Ali solubility (mg/ml) | 0.000212 |
| Ali solubility (mol/l) | 0.00000043 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.28 |
| Silicos-it solubility (mg/ml) | 2.56E-08 |
| Silicos-it solubility (mol/l) | 5.28E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.78 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.51 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.546 |
| Logd | 4.425 |
| Logp | 5.148 |
| F (20%) | 0.001 |
| F (30%) | 0.042 |
| Mdck | - |
| Ppb | 96.18% |
| Vdss | 3.762 |
| Fu | 1.90% |
| Cyp1a2-inh | 0.407 |
| Cyp1a2-sub | 0.159 |
| Cyp2c19-inh | 0.889 |
| Cyp2c19-sub | 0.068 |
| Cl | 3.237 |
| T12 | 0.035 |
| H-ht | 0.37 |
| Dili | 0.986 |
| Roa | 0.611 |
| Fdamdd | 0.515 |
| Skinsen | 0.057 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.962 |
| Bcf | 2.847 |
| Igc50 | 4.872 |
| Lc50 | 5.889 |
| Lc50dm | 4.879 |
| Nr-ar | 0.005 |
| Nr-ar-lbd | 0.166 |
| Nr-ahr | 0.962 |
| Nr-aromatase | 0.992 |
| Nr-er | 0.949 |
| Nr-er-lbd | 0.334 |
| Nr-ppar-gamma | 0.176 |
| Sr-are | 0.969 |
| Sr-atad5 | 0.966 |
| Sr-hse | 0.35 |
| Sr-mmp | 0.88 |
| Sr-p53 | 0.949 |
| Vol | 432.416 |
| Dense | 1.115 |
| Flex | 0.143 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.298 |
| Synth | 2.627 |
| Fsp3 | 0.045 |
| Mce-18 | 27 |
| Natural product-likeness | -1.493 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |