| General Information | |
|---|---|
| ZINC ID | ZINC000045394210 |
| Molecular Weight (Da) | 304 |
| SMILES | C[C@H]1CC[C@@H](C)N1c1ccc(-c2cccc3cnccc23)nn1 |
| Molecular Formula | C19N4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 93.941 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| LogP | 3.837 |
| Activity (Ki) in nM | 39.811 |
| Polar Surface Area (PSA) | 41.91 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.74503958 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.32 |
| Ilogp | 3.03 |
| Xlogp3 | 3.5 |
| Wlogp | 3.69 |
| Mlogp | 2.8 |
| Silicos-it log p | 3.36 |
| Consensus log p | 3.28 |
| Esol log s | -4.31 |
| Esol solubility (mg/ml) | 1.47E-02 |
| Esol solubility (mol/l) | 4.84E-05 |
| Esol class | Moderately |
| Ali log s | -4.06 |
| Ali solubility (mg/ml) | 2.63E-02 |
| Ali solubility (mol/l) | 8.64E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -6.22 |
| Silicos-it solubility (mg/ml) | 1.84E-04 |
| Silicos-it solubility (mol/l) | 6.05E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.67 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 0 |
| Synthetic accessibility | 3.32 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.773 |
| Logd | 3.451 |
| Logp | 4.319 |
| F (20%) | 0.001 |
| F (30%) | 0.007 |
| Mdck | 3.90E-05 |
| Ppb | 0.9058 |
| Vdss | 2.277 |
| Fu | 0.0722 |
| Cyp1a2-inh | 0.965 |
| Cyp1a2-sub | 0.513 |
| Cyp2c19-inh | 0.914 |
| Cyp2c19-sub | 0.589 |
| Cl | 5.584 |
| T12 | 0.128 |
| H-ht | 0.986 |
| Dili | 0.966 |
| Roa | 0.306 |
| Fdamdd | 0.55 |
| Skinsen | 0.922 |
| Ec | 0.004 |
| Ei | 0.052 |
| Respiratory | 0.962 |
| Bcf | 2.79 |
| Igc50 | 4.356 |
| Lc50 | 4.77 |
| Lc50dm | 5.138 |
| Nr-ar | 0.004 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.507 |
| Nr-aromatase | 0.953 |
| Nr-er | 0.44 |
| Nr-er-lbd | 0.281 |
| Nr-ppar-gamma | 0.006 |
| Sr-are | 0.727 |
| Sr-atad5 | 0.009 |
| Sr-hse | 0.02 |
| Sr-mmp | 0.396 |
| Sr-p53 | 0.223 |
| Vol | 325.85 |
| Dense | 0.933 |
| Flex | 22 |
| Nstereo | 0.091 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0 |
| Synth | 0.715 |
| Fsp3 | 3.195 |
| Mce-18 | 0.316 |
| Natural product-likeness | 66.4 |
| Alarm nmr | -1.165 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |