| General Information | |
|---|---|
| ZINC ID | ZINC000045387015 |
| Molecular Weight (Da) | 481 |
| SMILES | CC(=O)C1CCN(C(=O)c2nn(-c3ccccc3Cl)c(-c3ccc(Cl)cc3)c2CC#N)CC1 |
| Molecular Formula | C25Cl2N4O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 130.861 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| LogP | 4.68 |
| Activity (Ki) in nM | 199.526 |
| Polar Surface Area (PSA) | 78.99 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.12483274 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.28 |
| Ilogp | 3.59 |
| Xlogp3 | 4.44 |
| Wlogp | 4.97 |
| Mlogp | 3.45 |
| Silicos-it log p | 5.17 |
| Consensus log p | 4.32 |
| Esol log s | -5.61 |
| Esol solubility (mg/ml) | 0.00119 |
| Esol solubility (mol/l) | 0.00000247 |
| Esol class | Moderately |
| Ali log s | -5.82 |
| Ali solubility (mg/ml) | 0.000733 |
| Ali solubility (mol/l) | 0.00000152 |
| Ali class | Moderately |
| Silicos-it logsw | -7.79 |
| Silicos-it solubility (mg/ml) | 0.00000784 |
| Silicos-it solubility (mol/l) | 1.63E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.08 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.39 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.673 |
| Logd | 3.625 |
| Logp | 3.765 |
| F (20%) | 0.002 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 94.77% |
| Vdss | 0.77 |
| Fu | 6.51% |
| Cyp1a2-inh | 0.217 |
| Cyp1a2-sub | 0.848 |
| Cyp2c19-inh | 0.91 |
| Cyp2c19-sub | 0.08 |
| Cl | 3.291 |
| T12 | 0.147 |
| H-ht | 0.842 |
| Dili | 0.942 |
| Roa | 0.961 |
| Fdamdd | 0.197 |
| Skinsen | 0.078 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.223 |
| Bcf | 1.316 |
| Igc50 | 3.881 |
| Lc50 | 5.006 |
| Lc50dm | 5.075 |
| Nr-ar | 0.038 |
| Nr-ar-lbd | 0.187 |
| Nr-ahr | 0.556 |
| Nr-aromatase | 0.9 |
| Nr-er | 0.481 |
| Nr-er-lbd | 0.217 |
| Nr-ppar-gamma | 0.169 |
| Sr-are | 0.752 |
| Sr-atad5 | 0.04 |
| Sr-hse | 0.052 |
| Sr-mmp | 0.278 |
| Sr-p53 | 0.904 |
| Vol | 467.082 |
| Dense | 1.028 |
| Flex | 0.231 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.492 |
| Synth | 2.576 |
| Fsp3 | 0.28 |
| Mce-18 | 55.5 |
| Natural product-likeness | -1.323 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |