| General Information | |
|---|---|
| ZINC ID | ZINC000045387008 |
| Molecular Weight (Da) | 496 |
| SMILES | CN1CCN(C(=O)c2nn(-c3ccccc3Cl)c(-c3ccc(Cl)cc3)c2Cn2cncn2)CC1 |
| Molecular Formula | C24Cl2N7O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 137.413 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| LogP | 3.526 |
| Activity (Ki) in nM | 954.993 |
| Polar Surface Area (PSA) | 72.08 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.16215622 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.25 |
| Ilogp | 3.51 |
| Xlogp3 | 4.09 |
| Wlogp | 3.11 |
| Mlogp | 3.25 |
| Silicos-it log p | 2.94 |
| Consensus log p | 3.38 |
| Esol log s | -5.58 |
| Esol solubility (mg/ml) | 0.00131 |
| Esol solubility (mol/l) | 0.00000265 |
| Esol class | Moderately |
| Ali log s | -5.31 |
| Ali solubility (mg/ml) | 0.00244 |
| Ali solubility (mol/l) | 0.00000491 |
| Ali class | Moderately |
| Silicos-it logsw | -7.18 |
| Silicos-it solubility (mg/ml) | 0.0000326 |
| Silicos-it solubility (mol/l) | 6.58E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.42 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.64 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.184 |
| Logd | 3.274 |
| Logp | 2.93 |
| F (20%) | 0.004 |
| F (30%) | 0.009 |
| Mdck | - |
| Ppb | 93.14% |
| Vdss | 1.686 |
| Fu | 8.80% |
| Cyp1a2-inh | 0.354 |
| Cyp1a2-sub | 0.616 |
| Cyp2c19-inh | 0.883 |
| Cyp2c19-sub | 0.814 |
| Cl | 8.336 |
| T12 | 0.184 |
| H-ht | 0.621 |
| Dili | 0.983 |
| Roa | 0.521 |
| Fdamdd | 0.281 |
| Skinsen | 0.681 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.082 |
| Bcf | 1.274 |
| Igc50 | 2.723 |
| Lc50 | 4.187 |
| Lc50dm | 3.765 |
| Nr-ar | 0.026 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.803 |
| Nr-aromatase | 0.896 |
| Nr-er | 0.12 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.008 |
| Sr-are | 0.722 |
| Sr-atad5 | 0.019 |
| Sr-hse | 0.008 |
| Sr-mmp | 0.152 |
| Sr-p53 | 0.242 |
| Vol | 468.066 |
| Dense | 1.058 |
| Flex | 0.207 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.42 |
| Synth | 2.578 |
| Fsp3 | 0.25 |
| Mce-18 | 61.2 |
| Natural product-likeness | -1.805 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |