| General Information | |
|---|---|
| ZINC ID | ZINC000045354493 |
| Molecular Weight (Da) | 493 |
| SMILES | CN(Cc1ccc(F)cc1)C(=O)c1nn(-c2ccccc2Cl)c(-c2ccc(Cl)cc2)c1CC#N |
| Molecular Formula | C26Cl2F1N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 133.758 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| LogP | 6.407 |
| Activity (Ki) in nM | 5.6234 |
| Polar Surface Area (PSA) | 61.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.202 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 23 |
| Fraction csp3 | 0.12 |
| Ilogp | 3.76 |
| Xlogp3 | 5.85 |
| Wlogp | 6.59 |
| Mlogp | 4.69 |
| Silicos-it log p | 6.13 |
| Consensus log p | 5.4 |
| Esol log s | -6.62 |
| Esol solubility (mg/ml) | 0.000118 |
| Esol solubility (mol/l) | 0.00000023 |
| Esol class | Poorly sol |
| Ali log s | -6.92 |
| Ali solubility (mg/ml) | 0.000059 |
| Ali solubility (mol/l) | 0.00000012 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.87 |
| Silicos-it solubility (mg/ml) | 6.67E-08 |
| Silicos-it solubility (mol/l) | 1.35E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.16 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.37 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.777 |
| Logd | 4.388 |
| Logp | 5.026 |
| F (20%) | 0.004 |
| F (30%) | 0.004 |
| Mdck | - |
| Ppb | 97.53% |
| Vdss | 0.504 |
| Fu | 1.82% |
| Cyp1a2-inh | 0.307 |
| Cyp1a2-sub | 0.85 |
| Cyp2c19-inh | 0.921 |
| Cyp2c19-sub | 0.069 |
| Cl | 5.105 |
| T12 | 0.036 |
| H-ht | 0.201 |
| Dili | 0.978 |
| Roa | 0.688 |
| Fdamdd | 0.465 |
| Skinsen | 0.022 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.344 |
| Bcf | 2.286 |
| Igc50 | 4.853 |
| Lc50 | 6.628 |
| Lc50dm | 6.262 |
| Nr-ar | 0.016 |
| Nr-ar-lbd | 0.262 |
| Nr-ahr | 0.326 |
| Nr-aromatase | 0.871 |
| Nr-er | 0.442 |
| Nr-er-lbd | 0.017 |
| Nr-ppar-gamma | 0.703 |
| Sr-are | 0.755 |
| Sr-atad5 | 0.012 |
| Sr-hse | 0.07 |
| Sr-mmp | 0.848 |
| Sr-p53 | 0.879 |
| Vol | 476.383 |
| Dense | 1.033 |
| Flex | 0.28 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.316 |
| Synth | 2.499 |
| Fsp3 | 0.115 |
| Mce-18 | 24 |
| Natural product-likeness | -1.779 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |