| General Information | |
|---|---|
| ZINC ID | ZINC000045299928 |
| Molecular Weight (Da) | 471 |
| SMILES | COc1ccc(CCNC(=O)c2nn(-c3ccc(F)cc3F)c(-n3cccc3)c2C)cc1Cl |
| Molecular Formula | C24Cl1F2N4O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 121.551 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| LogP | 5.371 |
| Activity (Ki) in nM | 1949.845 |
| Polar Surface Area (PSA) | 61.08 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.91438108 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.17 |
| Ilogp | 4.38 |
| Xlogp3 | 5.36 |
| Wlogp | 5.72 |
| Mlogp | 4.42 |
| Silicos-it log p | 4.97 |
| Consensus log p | 4.97 |
| Esol log s | -6.1 |
| Esol solubility (mg/ml) | 0.000373 |
| Esol solubility (mol/l) | 0.00000079 |
| Esol class | Poorly sol |
| Ali log s | -6.4 |
| Ali solubility (mg/ml) | 0.000189 |
| Ali solubility (mol/l) | 0.0000004 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.7 |
| Silicos-it solubility (mg/ml) | 0.00000094 |
| Silicos-it solubility (mol/l) | 0 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.37 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.27 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.895 |
| Logd | 4.059 |
| Logp | 4.611 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | 2.38E-05 |
| Ppb | 0.9819 |
| Vdss | 0.54 |
| Fu | 0.0163 |
| Cyp1a2-inh | 0.436 |
| Cyp1a2-sub | 0.902 |
| Cyp2c19-inh | 0.964 |
| Cyp2c19-sub | 0.504 |
| Cl | 6.332 |
| T12 | 0.154 |
| H-ht | 0.602 |
| Dili | 0.935 |
| Roa | 0.047 |
| Fdamdd | 0.955 |
| Skinsen | 0.103 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.048 |
| Bcf | 2.144 |
| Igc50 | 4.187 |
| Lc50 | 5.163 |
| Lc50dm | 6.56 |
| Nr-ar | 0.038 |
| Nr-ar-lbd | 0.011 |
| Nr-ahr | 0.84 |
| Nr-aromatase | 0.964 |
| Nr-er | 0.281 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.623 |
| Sr-are | 0.821 |
| Sr-atad5 | 0.36 |
| Sr-hse | 0.03 |
| Sr-mmp | 0.502 |
| Sr-p53 | 0.876 |
| Vol | 449.347 |
| Dense | 1.046 |
| Flex | 0.348 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.418 |
| Synth | 2.578 |
| Fsp3 | 0.167 |
| Mce-18 | 24 |
| Natural product-likeness | -1.755 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |