| General Information | |
|---|---|
| ZINC ID | ZINC000045257854 |
| Molecular Weight (Da) | 345 |
| SMILES | Cc1cnc(NC(=O)[C@]2(C)CCCC[C@H]2C)cc1CN1CCOCC1 |
| Molecular Formula | C20N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 100.207 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| LogP | 3.384 |
| Activity (Ki) in nM | 2511.89 |
| Polar Surface Area (PSA) | 54.46 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.73 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.7 |
| Ilogp | 3.12 |
| Xlogp3 | 3.07 |
| Wlogp | 2.65 |
| Mlogp | 2.16 |
| Silicos-it log p | 3.56 |
| Consensus log p | 2.91 |
| Esol log s | -3.76 |
| Esol solubility (mg/ml) | 0.0595 |
| Esol solubility (mol/l) | 0.000172 |
| Esol class | Soluble |
| Ali log s | -3.88 |
| Ali solubility (mg/ml) | 0.0455 |
| Ali solubility (mol/l) | 0.000132 |
| Ali class | Soluble |
| Silicos-it logsw | -5.17 |
| Silicos-it solubility (mg/ml) | 0.00236 |
| Silicos-it solubility (mol/l) | 0.00000682 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.23 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 0 |
| Synthetic accessibility | 3.71 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.243 |
| Logd | 3.533 |
| Logp | 3.433 |
| F (20%) | 0.772 |
| F (30%) | 0.011 |
| Mdck | - |
| Ppb | 67.75% |
| Vdss | 1.309 |
| Fu | 37.22% |
| Cyp1a2-inh | 0.121 |
| Cyp1a2-sub | 0.663 |
| Cyp2c19-inh | 0.823 |
| Cyp2c19-sub | 0.772 |
| Cl | 6.955 |
| T12 | 0.514 |
| H-ht | 0.645 |
| Dili | 0.34 |
| Roa | 0.952 |
| Fdamdd | 0.748 |
| Skinsen | 0.8 |
| Ec | 0.004 |
| Ei | 0.016 |
| Respiratory | 0.497 |
| Bcf | 0.461 |
| Igc50 | 3.235 |
| Lc50 | 4.706 |
| Lc50dm | 4.729 |
| Nr-ar | 0.057 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.702 |
| Nr-aromatase | 0.887 |
| Nr-er | 0.201 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.004 |
| Sr-are | 0.184 |
| Sr-atad5 | 0.01 |
| Sr-hse | 0.171 |
| Sr-mmp | 0.22 |
| Sr-p53 | 0.167 |
| Vol | 368.832 |
| Dense | 0.936 |
| Flex | 0.2 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.916 |
| Synth | 3.945 |
| Fsp3 | 0.7 |
| Mce-18 | 64.588 |
| Natural product-likeness | -0.446 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |