| General Information | |
|---|---|
| ZINC ID | ZINC000045256282 |
| Molecular Weight (Da) | 327 |
| SMILES | CC1(C)C(C(=O)c2cn(CC3OCCO3)c3ccccc23)C1(C)C |
| Molecular Formula | C20N1O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 90.627 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| LogP | 3.272 |
| Activity (Ki) in nM | 1 |
| Polar Surface Area (PSA) | 40.46 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.95220804 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.55 |
| Ilogp | 3.42 |
| Xlogp3 | 3.38 |
| Wlogp | 3.88 |
| Mlogp | 2.41 |
| Silicos-it log p | 4.02 |
| Consensus log p | 3.42 |
| Esol log s | -4.01 |
| Esol solubility (mg/ml) | 0.0318 |
| Esol solubility (mol/l) | 0.0000971 |
| Esol class | Moderately |
| Ali log s | -3.91 |
| Ali solubility (mg/ml) | 0.0404 |
| Ali solubility (mol/l) | 0.000124 |
| Ali class | Soluble |
| Silicos-it logsw | -4.99 |
| Silicos-it solubility (mg/ml) | 0.00334 |
| Silicos-it solubility (mol/l) | 0.0000102 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.9 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 0 |
| Synthetic accessibility | 2.83 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.806 |
| Logd | 3.514 |
| Logp | 4.222 |
| F (20%) | 0.009 |
| F (30%) | 0.003 |
| Mdck | 2.73E-05 |
| Ppb | 0.9261 |
| Vdss | 1.712 |
| Fu | 0.0729 |
| Cyp1a2-inh | 0.067 |
| Cyp1a2-sub | 0.135 |
| Cyp2c19-inh | 0.814 |
| Cyp2c19-sub | 0.633 |
| Cl | 5.141 |
| T12 | 0.071 |
| H-ht | 0.301 |
| Dili | 0.941 |
| Roa | 0.339 |
| Fdamdd | 0.132 |
| Skinsen | 0.159 |
| Ec | 0.003 |
| Ei | 0.121 |
| Respiratory | 0.894 |
| Bcf | 1.658 |
| Igc50 | 4.154 |
| Lc50 | 5.049 |
| Lc50dm | 5.707 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.252 |
| Nr-aromatase | 0.913 |
| Nr-er | 0.247 |
| Nr-er-lbd | 0.372 |
| Nr-ppar-gamma | 0.008 |
| Sr-are | 0.213 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.035 |
| Sr-mmp | 0.4 |
| Sr-p53 | 0.038 |
| Vol | 344.435 |
| Dense | 0.95 |
| Flex | 0.211 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 3 |
| Qed | 0.8 |
| Synth | 2.845 |
| Fsp3 | 0.55 |
| Mce-18 | 59.677 |
| Natural product-likeness | -0.341 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |