| General Information | |
|---|---|
| ZINC ID | ZINC000044417998 |
| Molecular Weight (Da) | 545 |
| SMILES | CC(C)(C)c1nnc(-c2nn(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)c2C(=O)N2CCCC2)o1 |
| Molecular Formula | C26Cl3N5O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 143.299 |
| HBA | 5 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| LogP | 6.936 |
| Activity (Ki) in nM | 93.3254 |
| Polar Surface Area (PSA) | 77.05 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.96352785 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.31 |
| Ilogp | 4.45 |
| Xlogp3 | 6.62 |
| Wlogp | 6.7 |
| Mlogp | 4.9 |
| Silicos-it log p | 6.27 |
| Consensus log p | 5.79 |
| Esol log s | -7.44 |
| Esol solubility (mg/ml) | 0.0000196 |
| Esol solubility (mol/l) | 3.59E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.04 |
| Ali solubility (mg/ml) | 0.00000498 |
| Ali solubility (mol/l) | 9.14E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.65 |
| Silicos-it solubility (mg/ml) | 0.00000012 |
| Silicos-it solubility (mol/l) | 2.23E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.92 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.01 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.917 |
| Logd | 4.588 |
| Logp | 5.865 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 97.74% |
| Vdss | 0.959 |
| Fu | 2.26% |
| Cyp1a2-inh | 0.16 |
| Cyp1a2-sub | 0.678 |
| Cyp2c19-inh | 0.869 |
| Cyp2c19-sub | 0.073 |
| Cl | 4.469 |
| T12 | 0.01 |
| H-ht | 0.605 |
| Dili | 0.978 |
| Roa | 0.544 |
| Fdamdd | 0.189 |
| Skinsen | 0.048 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.608 |
| Bcf | 2.263 |
| Igc50 | 4.93 |
| Lc50 | 5.785 |
| Lc50dm | 4.878 |
| Nr-ar | 0.004 |
| Nr-ar-lbd | 0.207 |
| Nr-ahr | 0.194 |
| Nr-aromatase | 0.963 |
| Nr-er | 0.771 |
| Nr-er-lbd | 0.041 |
| Nr-ppar-gamma | 0.665 |
| Sr-are | 0.903 |
| Sr-atad5 | 0.016 |
| Sr-hse | 0.173 |
| Sr-mmp | 0.928 |
| Sr-p53 | 0.895 |
| Vol | 504.666 |
| Dense | 1.076 |
| Flex | 0.214 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.274 |
| Synth | 2.747 |
| Fsp3 | 0.308 |
| Mce-18 | 69.294 |
| Natural product-likeness | -1.433 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |