| General Information | |
|---|---|
| ZINC ID | ZINC000043203465 |
| Molecular Weight (Da) | 394 |
| SMILES | CCCCCN1N=C(C(=O)NC2C3CC4CC(C3)CC2C4)C[C@H]1c1ccccc1 |
| Molecular Formula | C25N3O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 116.604 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| LogP | 5.075 |
| Activity (Ki) in nM | 7.9433 |
| Polar Surface Area (PSA) | 44.7 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 0.661 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.68 |
| Ilogp | 4.2 |
| Xlogp3 | 5.37 |
| Wlogp | 3.83 |
| Mlogp | 4.11 |
| Silicos-it log p | 4.53 |
| Consensus log p | 4.41 |
| Esol log s | -5.29 |
| Esol solubility (mg/ml) | 0.00203 |
| Esol solubility (mol/l) | 0.00000515 |
| Esol class | Moderately |
| Ali log s | -6.06 |
| Ali solubility (mg/ml) | 0.000341 |
| Ali solubility (mol/l) | 0.00000086 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.92 |
| Silicos-it solubility (mg/ml) | 0.000476 |
| Silicos-it solubility (mol/l) | 0.00000121 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.89 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 6.34 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.767 |
| Logd | 5.065 |
| Logp | 5.468 |
| F (20%) | 0.011 |
| F (30%) | 0.043 |
| Mdck | - |
| Ppb | 95.82% |
| Vdss | 1.512 |
| Fu | 1.58% |
| Cyp1a2-inh | 0.064 |
| Cyp1a2-sub | 0.244 |
| Cyp2c19-inh | 0.841 |
| Cyp2c19-sub | 0.071 |
| Cl | 6.419 |
| T12 | 0.015 |
| H-ht | 0.042 |
| Dili | 0.105 |
| Roa | 0.151 |
| Fdamdd | 0.04 |
| Skinsen | 0.021 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.551 |
| Bcf | 3.532 |
| Igc50 | 5.086 |
| Lc50 | 6.166 |
| Lc50dm | 6.307 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.006 |
| Nr-aromatase | 0.78 |
| Nr-er | 0.311 |
| Nr-er-lbd | 0.041 |
| Nr-ppar-gamma | 0.001 |
| Sr-are | 0.182 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.164 |
| Sr-mmp | 0.867 |
| Sr-p53 | 0.006 |
| Vol | 426.772 |
| Dense | 0.922 |
| Flex | 0.348 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.482 |
| Synth | 4.368 |
| Fsp3 | 0.64 |
| Mce-18 | 87.195 |
| Natural product-likeness | -0.561 |
| Alarm nmr | 0 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |