| General Information | |
|---|---|
| ZINC ID | ZINC000043177173 |
| Molecular Weight (Da) | 496 |
| SMILES | CSc1c(C(=O)NN2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C22Cl3N4O1S1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 130.822 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 6.737 |
| Activity (Ki) in nM | 1 |
| Polar Surface Area (PSA) | 75.46 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.854 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.27 |
| Ilogp | 4.5 |
| Xlogp3 | 6.64 |
| Wlogp | 5.97 |
| Mlogp | 5.35 |
| Silicos-it log p | 5.16 |
| Consensus log p | 5.52 |
| Esol log s | -7.11 |
| Esol solubility (mg/ml) | 0.0000387 |
| Esol solubility (mol/l) | 7.81E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.03 |
| Ali solubility (mg/ml) | 0.00000467 |
| Ali solubility (mol/l) | 9.41E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.34 |
| Silicos-it solubility (mg/ml) | 0.00000226 |
| Silicos-it solubility (mol/l) | 4.56E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.61 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.57 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.183 |
| Logd | 4.867 |
| Logp | 5.656 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 99.47% |
| Vdss | 0.887 |
| Fu | 1.59% |
| Cyp1a2-inh | 0.292 |
| Cyp1a2-sub | 0.789 |
| Cyp2c19-inh | 0.928 |
| Cyp2c19-sub | 0.661 |
| Cl | 7.615 |
| T12 | 0.018 |
| H-ht | 0.716 |
| Dili | 0.98 |
| Roa | 0.137 |
| Fdamdd | 0.44 |
| Skinsen | 0.155 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.716 |
| Bcf | 1.984 |
| Igc50 | 4.993 |
| Lc50 | 6.436 |
| Lc50dm | 6.266 |
| Nr-ar | 0.006 |
| Nr-ar-lbd | 0.01 |
| Nr-ahr | 0.927 |
| Nr-aromatase | 0.93 |
| Nr-er | 0.793 |
| Nr-er-lbd | 0.028 |
| Nr-ppar-gamma | 0.765 |
| Sr-are | 0.928 |
| Sr-atad5 | 0.072 |
| Sr-hse | 0.837 |
| Sr-mmp | 0.955 |
| Sr-p53 | 0.97 |
| Vol | 448.034 |
| Dense | 1.103 |
| Flex | 0.25 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.419 |
| Synth | 2.659 |
| Fsp3 | 0.273 |
| Mce-18 | 54.214 |
| Natural product-likeness | -1.364 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |