| General Information | |
|---|---|
| ZINC ID | ZINC000043103655 |
| Molecular Weight (Da) | 596 |
| SMILES | O=S(=O)(c1cc2ccccc2n1S(=O)(=O)c1ccccc1F)N1CCC2(CC1)C[C@@H]2NS(=O)(=O)C(F)(F)F |
| Molecular Formula | C22F4N3O6S3 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 127.885 |
| HBA | 6 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| LogP | 4.678 |
| Activity (Ki) in nM | 1 |
| Polar Surface Area (PSA) | 147.76 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.09977698 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.36 |
| Ilogp | 2.76 |
| Xlogp3 | 3.93 |
| Wlogp | 7.54 |
| Mlogp | 2.59 |
| Silicos-it log p | 0.81 |
| Consensus log p | 3.53 |
| Esol log s | -5.84 |
| Esol solubility (mg/ml) | 8.63E-04 |
| Esol solubility (mol/l) | 1.45E-06 |
| Esol class | Moderately |
| Ali log s | -6.73 |
| Ali solubility (mg/ml) | 1.10E-04 |
| Ali solubility (mol/l) | 1.85E-07 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.71 |
| Silicos-it solubility (mg/ml) | 1.17E-04 |
| Silicos-it solubility (mol/l) | 1.97E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -7.14 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 1 |
| Egan number of violations | 2 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.85 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.33 |
| Logd | 3.508 |
| Logp | 4.781 |
| F (20%) | 0.065 |
| F (30%) | 0.008 |
| Mdck | 8.08E-05 |
| Ppb | 0.9541 |
| Vdss | 0.347 |
| Fu | 0.0642 |
| Cyp1a2-inh | 0.157 |
| Cyp1a2-sub | 0.152 |
| Cyp2c19-inh | 0.412 |
| Cyp2c19-sub | 0.498 |
| Cl | 3.348 |
| T12 | 0.028 |
| H-ht | 0.98 |
| Dili | 0.994 |
| Roa | 0.027 |
| Fdamdd | 0.991 |
| Skinsen | 0.018 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.881 |
| Bcf | 0.823 |
| Igc50 | 3.279 |
| Lc50 | 4.296 |
| Lc50dm | 5.239 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.101 |
| Nr-ahr | 0.108 |
| Nr-aromatase | 0.455 |
| Nr-er | 0.149 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.221 |
| Sr-are | 0.797 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.008 |
| Sr-mmp | 0.867 |
| Sr-p53 | 0.131 |
| Vol | 493.36 |
| Dense | 1.206 |
| Flex | 31 |
| Nstereo | 0.226 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 3 |
| Synth | 0.438 |
| Fsp3 | 4.035 |
| Mce-18 | 0.364 |
| Natural product-likeness | 169.733 |
| Alarm nmr | -0.889 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Rejected |