| General Information | |
|---|---|
| ZINC ID | ZINC000043080717 |
| Molecular Weight (Da) | 568 |
| SMILES | C[C@H](Nc1cc(N2CCC(C(F)(F)F)CC2)ncn1)[C@@H](Cc1ccc(Cl)cc1)c1cccc(Br)c1 |
| Molecular Formula | C26Br1Cl1F3N4 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 140.932 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| LogP | 8.133 |
| Activity (Ki) in nM | 75.8578 |
| Polar Surface Area (PSA) | 41.05 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.081 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.38 |
| Ilogp | 4.6 |
| Xlogp3 | 8.29 |
| Wlogp | 8.19 |
| Mlogp | 5.86 |
| Silicos-it log p | 6.73 |
| Consensus log p | 6.73 |
| Esol log s | -8.44 |
| Esol solubility (mg/ml) | 0.00000208 |
| Esol solubility (mol/l) | 3.66E-09 |
| Esol class | Poorly sol |
| Ali log s | -9.02 |
| Ali solubility (mg/ml) | 0.00000054 |
| Ali solubility (mol/l) | 9.64E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.21 |
| Silicos-it solubility (mg/ml) | 3.46E-08 |
| Silicos-it solubility (mol/l) | 6.10E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.88 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.26 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.606 |
| Logd | 4.818 |
| Logp | 6.948 |
| F (20%) | 0.003 |
| F (30%) | 0.007 |
| Mdck | - |
| Ppb | 98.87% |
| Vdss | 3.702 |
| Fu | 0.74% |
| Cyp1a2-inh | 0.705 |
| Cyp1a2-sub | 0.554 |
| Cyp2c19-inh | 0.896 |
| Cyp2c19-sub | 0.153 |
| Cl | 5.314 |
| T12 | 0.004 |
| H-ht | 0.917 |
| Dili | 0.301 |
| Roa | 0.673 |
| Fdamdd | 0.911 |
| Skinsen | 0.042 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.788 |
| Bcf | 3.435 |
| Igc50 | 5.073 |
| Lc50 | 6.141 |
| Lc50dm | 6.514 |
| Nr-ar | 0.299 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.495 |
| Nr-aromatase | 0.934 |
| Nr-er | 0.276 |
| Nr-er-lbd | 0.012 |
| Nr-ppar-gamma | 0.009 |
| Sr-are | 0.543 |
| Sr-atad5 | 0.01 |
| Sr-hse | 0.761 |
| Sr-mmp | 0.736 |
| Sr-p53 | 0.362 |
| Vol | 496.983 |
| Dense | 1.139 |
| Flex | 0.28 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 2 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.351 |
| Synth | 3.939 |
| Fsp3 | 0.385 |
| Mce-18 | 81.944 |
| Natural product-likeness | -0.791 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |