| General Information | |
|---|---|
| ZINC ID | ZINC000043067280 |
| Molecular Weight (Da) | 514 |
| SMILES | CC[C@H](Nc1cc(NC2CCCC2)ncn1)[C@@H](Cc1ccc(Cl)cc1)c1cccc(Br)c1 |
| Molecular Formula | C26Br1Cl1N4 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 140.086 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| LogP | 8.181 |
| Activity (Ki) in nM | 63.0957 |
| Polar Surface Area (PSA) | 49.84 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.926 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.38 |
| Ilogp | 4.6 |
| Xlogp3 | 8.09 |
| Wlogp | 7.08 |
| Mlogp | 5.57 |
| Silicos-it log p | 6.57 |
| Consensus log p | 6.38 |
| Esol log s | -7.95 |
| Esol solubility (mg/ml) | 0.00000583 |
| Esol solubility (mol/l) | 1.13E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.99 |
| Ali solubility (mg/ml) | 0.00000052 |
| Ali solubility (mol/l) | 1.02E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.51 |
| Silicos-it solubility (mg/ml) | 1.57E-08 |
| Silicos-it solubility (mol/l) | 3.06E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.69 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.08 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.268 |
| Logd | 4.725 |
| Logp | 6.849 |
| F (20%) | 0.004 |
| F (30%) | 0.294 |
| Mdck | - |
| Ppb | 98.13% |
| Vdss | 3.085 |
| Fu | 0.91% |
| Cyp1a2-inh | 0.94 |
| Cyp1a2-sub | 0.265 |
| Cyp2c19-inh | 0.927 |
| Cyp2c19-sub | 0.066 |
| Cl | 4.239 |
| T12 | 0.018 |
| H-ht | 0.428 |
| Dili | 0.831 |
| Roa | 0.825 |
| Fdamdd | 0.907 |
| Skinsen | 0.285 |
| Ec | 0.003 |
| Ei | 0.084 |
| Respiratory | 0.753 |
| Bcf | 3.003 |
| Igc50 | 5.193 |
| Lc50 | 6.353 |
| Lc50dm | 6.443 |
| Nr-ar | 0.053 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.889 |
| Nr-aromatase | 0.948 |
| Nr-er | 0.686 |
| Nr-er-lbd | 0.011 |
| Nr-ppar-gamma | 0.051 |
| Sr-are | 0.48 |
| Sr-atad5 | 0.261 |
| Sr-hse | 0.88 |
| Sr-mmp | 0.925 |
| Sr-p53 | 0.598 |
| Vol | 478.78 |
| Dense | 1.07 |
| Flex | 0.333 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.345 |
| Synth | 3.844 |
| Fsp3 | 0.385 |
| Mce-18 | 68.833 |
| Natural product-likeness | -0.558 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |